Metolachlor ethane sulfonic acid (Ref: CGA 354743) |

Last updated: 14/11/2024
|
 |
(Also known as: ethylsulfonic acid metabolite; ethanesulphonic acid metabolite; ESA; ethanesulfonic acid metabolite; alachlor ethanesulfonic acid; metolachlor sulfonic acid; ethane sulphonate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Chemical transformation product |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₁₅H₂₃NO₅S |
|
CCC1=CC=CC(=C1N(C(C)COC)C(=O)CS(=O)(=O)O)C |
|
No data |
|
CIGKZVUEZXGYSV-UHFFFAOYSA-N |
|
InChI=1S/C2H6O3S/c1-2-6(3,4)5/h2H2,1H3,(H,3,4,5) |
|
Yes |
|
Metabolite |
|
Soil |
|
Unclassified substance |
|
- |
|
- |
|
Synthetic |
|
Not applicable |
|
171118-09-5 |
|
- |
|
- |
|
- |
|
- |
|
329.41 |
|
- |
|
2-[2-ethyl-N-(1-methoxypropan-2-yl)-6-methylanilino]-2-oxoethanesulfonic acid |
|
2-((2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino)-2-oxoethanesulfonic acid |
|
Potential groundwater contaminant |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
212461 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
High |
|
- |
- |
- |
|
-17 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.29 X 10-02 |
Calculated |
- |
|
-1.89 |
C3 C = AGRITOX dataset. Dataset is no longer available. 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.35 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
400 |
|
Very persistent |
|
235 |
|
Persistent |
|
- |
- |
- |
|
975 |
|
Very persistent |
|
- |
- |
- |
|
235 |
geometric mean |
- |
|
EU 2018 dossier lab studies DT₅₀ (normalised) range 27.2->1000 days, DT₉₀ (measured) range 95.5->1000 days. Some literature susggests it can be detected in some soils for two or three years. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Very mobile |
|
9 |
|
EU dossier range 3-22 mL g⁻¹, 7 soils; Other sources: 13.5 mL g⁻¹ (R3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
7.22 |
Calculated |
High leachability |
|
|
6.62 X 1001 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Very mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
50 |
Eisenia foetida corr |
Moderate |
|
Nitrogen mineralisation: No significant adverse effect |
Dose: 3.92 mg kg⁻¹ soil |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
43 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
21.7 |
Lemna gibba |
Low |
|
> 100 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.00003 |
Crassostrea gigas Embryo |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No information available |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
metolachlor ethane sulfonic acid |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
kwas etanosulfonowy |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
14/11/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |