Leptophos (Ref: OMS 1438 ) |

Last updated: 22/08/2024
|
 |
(Also known as: VCS 506; MBCP) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obolete insecticide that is effective against lepidoptera and other insect pests |
|
Prodenia litura; Grasshoppers; Fleas; Beetles; Aphids; Thrips |
|
Cereals; Cotton; Lawns; Rice; Sugarcane; Sugarbeet; Lettuce; Tomatoes; Tobacco |
|
- |
|
Considered obsolete but may be available in some countries |
|
1969, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Leptophos is a chiral molecule. The technical material is an isomeric mixture. |
|
C₁₃H₁₀BrCl₂O₂PS |
|
COP(=S)(C1=CC=CC=C1)OC2=CC(=C(C=C2Cl)Br)Cl |
|
No data |
|
CVRALZAYCYJELZ-UHFFFAOYSA-N |
|
InChI=1S/C13H10BrCl2O2PS/c1-17-19(20,9-5-3-2-4-6-9)18-13-8-11(15)10(14)7-12(13)16/h2-8H,1H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
leptophos |
- |
 |
|
Insecticide |
|
Organophosphate insecticide; Phenyl phenylphosphonohioate insecticide |
|
Approx 85% pure |
|
- |
|
Synthetic |
|
Non-systemic. Acetylcholinesterase (AchE) inhibitor. |
|
21609-90-5 |
|
244-472-8 |
|
None allocated |
|
525300 |
|
30709 |
|
015-093-00-3 |
|
412.07 |
|
(E)-[O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate] |
|
(RS)-(O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphonothioate) |
|
O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Myzus persicae, Plutella xylostella, Spodoptera littoralis, Pectinophora gossypiella |
|
White solid |
|
|
|
|
|
|
|
Common formulations include emulsifiable concentrates, wettable powders and granules |
|
|
|
|
|
2.4 |
|
Low |
|
1300000 |
benzene |
- |
470 |
Acetone |
- |
142000 |
Cyclohexane |
- |
|
70.4 |
|
- |
|
Decomposes before boiling |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.04 X 1006 |
Calculated |
- |
|
6.31 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.53 |
|
- |
|
- |
- |
- |
- |
|
1.999 |
|
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Very persistent |
|
|
- |
- |
- |
|
- |
|
|
6.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 3.0-17.0 days, 9 field grown crops, various matrices, n=9 |
|
|
- |
- |
- |
|
- |
|
|
38.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
pH sensitive: 245 days at pH 6, 38.5 days at pH 7, 16 days at pH 8 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-mobile |
|
33000 |
|
Koc range 1175-117490 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6058 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
High potential |
|
not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
43.0 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 1500 |
Coturnix japonica |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 3400 |
Lumbricus terrestris |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.011 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.002 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
43.0 |
Rat |
High |
|
800 |
Rabbit |
- |
|
2.7 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I |
- |
- |
|
|
- |
|
May occur through dermal contact and inhalation of dust and sprays |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic |
|
|
|
Avoid generation of dust IMDG Transport Hazard Class 6.1 |
|
Health: H301, H312, H370 Environment: H400, H410 |
|
Ia (Extremely hazardous) |
|
UN2783 |
|
- |
|
- |
|
|
|
leptophos |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |