Hydramethylnon (Ref: BAS 315l) |

Last updated: 25/08/2024
|
 |
(Also known as: AC 217300; CL 217300) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An insecticide used in baits to control ants and cockroaches in both indoor and outdoor applications |
|
Ants, Fire ants, Cockroaches, Crickets, Termites, Silverfish |
|
Non-cropped areas |
|
- |
|
Current |
|
circa 1980, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
C₂₅H₂₄F₆N₄ |
|
CC1(CNC(=NC1)NN=C(C=CC2=CC=C(C=C2)C(F)(F)F)C=CC3=CC=C(C=C3)C(F)(F)F)C |
|
CC1(CN=C(NC1)NN=C(/C=C/C2=CC=C(C=C2)C(F)(F)F)/C=C/C3=CC=C(C=C3)C(F)(F)F)C |
|
IQVNEKKDSLOHHK-UHFFFAOYSA-N |
|
InChI=1S/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35)/b13-7+,14-8+ |
|
Yes |
|
Insecticide |
|
Pyrimidine insecticide; Guanidine insecticide; Hydrazone compound |
|
98% |
|
- |
|
Synthetic |
|
Non-systemic, selective with stomach action. Mitochondrial complex III electron transport inhibitor - at Qo site. |
|
67485-29-4 |
|
405-090-9 |
|
None allocated |
|
118401 |
|
5281875 |
|
613-181-00-1 |
|
494.48 |
|
- |
|
5,5-dimethylperhydropyrimidin-2-one 4-trifluoromethyl-α-(4-trifluoromethylstyryl)cinnamylidenehydrazone |
|
tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone [3-[4-(trifluoromethyl)phenyl]-1-[2-[4-(trifluoromethyl)phenyl]ethenyl]-2-propenylidene]hydrazone |
|
OSPAR soc; PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
20A |
|
Not applicable |
|
Blattella germanica |
|
Dark yellow crystalline solid |
|
|
|
- BASF
- Pacific Agriscience Pte. Ltd.
|
|
- Maxforce
- Amdro
- Siege
- Wipeout
- Pyramdron
|
|
Usually supplied in a ready to use oily bait formulation |
|
|
|
|
|
0.006 |
|
Low |
|
360000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
72000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
230000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
94000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
190 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.04 X 1002 |
Calculated |
- |
|
2.31 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.67 |
|
- |
|
- |
- |
- |
- |
|
2.70 X 10-03 |
|
Low volatility |
|
7.81 X 10-01 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
DW3 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 3 = Unverified data of known source |
Non-persistent |
|
10 |
|
Non-persistent |
|
7 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other sources: DT₅₀ 7-10 days (G3, L3), 10 days (DW4), 45 days (B3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
7 |
|
Moderately fast |
|
- |
|
|
10 |
|
Non-persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
730000 |
|
Other sources: Koc range 3300 - 8677 mL g⁻¹ (CA3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.57 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
34900 |
Whole fish |
High potential |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
1,5-bis(alpha, alpha, alpha-tri-fluoro-p-tolyl)-1,4-pentadiene-3-one |
- |
Water (Photolysis) |
- |
4H-pyrimido[2-1,C] as-triazio-4-one-1,6,7,8-tetrahydro-7,7-dimethyl-3-[p-(trifluoro-methyl)-styryl |
- |
Water (Photolysis) |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
> 1130 |
Rat |
Moderate |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
50 |
- |
|
- |
- |
- |
|
1828 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 30 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.16 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1.14 |
Daphnia magna |
Moderate |
|
> 0.00005 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.14 |
Chironomus plumosus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.018 |
Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1130 |
Rat |
Moderate |
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
> 5.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
Occupational exposure may occur through inhalation and dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
US EPA - possible human carcinogen |
|
|
|
No information available |
|
Health: H302, H319, H372 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
hydramethylnon |
|
hydramethylnon |
|
Hydramethylnon |
|
hydramethylnon |
|
idrametilnon |
|
hidrametilnona |
|
- |
|
hydrametylnon |
|
hydrametylnon |
|
- |
|
- |
|
- |
Record last updated: |
25/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |