| Zeatin |

Last updated: 16/05/2026
|
 |
(Also known as: cytokinin, constituent of; zeatine; (E)-zeatin ; 6-(4-Hydroxy-3-methylbut-2-enylamino) purine; oxyenadenine) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
|
|
|
Botanical plant growth regulator used to increase yields, blossom production and desirable growth effects. Also demonstates activity against some nematodes. |
|
|
Growth; Nematodes; Yield; Stress |
|
|
Variety of crops; Fruit trees; Ornamentals |
|
|
Zeatin has been used to promote plant growth for a long time and there is extensive research demonstrating its effectiveness. In one study, wheat seeds pretreated with Zeatins or demonstrated improved plant hormonal content, polyamine gene expression, and tolerance to salinity and drought stress. Similarly, maize seeds treated with a zeatin-type cytokinin biostimulator showed significantly improved salt tolerance by enhancing the antioxidant system and photosynthetic efficiency. Zeatin also increased the growth and biochemical parameters of an oregano crop. |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Isomeric. Zeatin exists in two forms: cis-zeatin and trans-zeatin. Trans-zeatin is the more biologically active form of zeatin. The cis-isomer has a much lower level of activity. |
|
|
C₁₀H₁₃N₅O |
|
|
CC(=CCNC1=NC=NC2=C1NC=N2)CO |
|
|
C/C(=C\CNC1=NC=NC2=C1NC=N2)/CO |
|
|
UZKQTCBAMSWPJD-FARCUNLSSA-N |
|
|
InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| cis-zeatin |
Isomer |
 |
|
|
Plant Growth Regulator; Other substance |
|
|
Biostimulant - growth enhancement & improved abiotic stress resiliance |
|
|
Plant-derived substance |
|
|
>98% |
|
|
- |
|
|
Natural |
|
|
Cytokinnin. Zeatin stimulates cell division and elongation, which leads to increased plant growth and biomass production. It enhances the uptake and utilisation of nutrients, improving overall plant health and productivity. Zeatin also regulates stress-responsive genes and pathways improving tolerance of drought and salt stress. Studies have also showed that it improves photosynthetic efficiency by increasing chlorophyll content and enhancing the activity of photosynthetic enzymes. |
|
|
A plant hormone belonging to the cytokinins family that was originally isolated from the kernels of sweet corn (Zea mays). |
|
|
Crop protection; Yield enhancement |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
1637-39-4 |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
219.25 |
|
|
- |
|
|
2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-ol |
|
|
(2E)-2-methyl-4-(1H-purin-6-ylamino)-2-buten-1-ol |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white to yellow crystalline powder |
|
|
|
|
|
|
|
|
Current |
|
|
1978, introduced USA |
|
|
- Duchefa Biochemie BV, NL
- Atlantic & Pacific Research
|
|
|
- |
|
|
Formulations include a soluble liquid concentrate, flowable concentrates and ready-to-use liquids |
|
|
Zeatin is produced commercially using biotechnological methods. Typically, this involves culturing microbes in a controlled fermentation environment. During fermentation, these microbes are provided with the necessary nutrients and conditions to produce the zeatin. After fermentation, the microbial culture undergoes downstream processing to extract and purify it. This involves several stages, including cell separation, extraction, and purification techniques to isolate the cytokinin from the microbial biomass. Zeatin can also be produced from brown seaweed. |
|
|
Measured GHG emissions data for Zeatin production are not available. Data would also vary significantly depending on the production process. Based on similar chemicals and processes, a rough estimate for synthetic production is in the region of 5–12 kg CO₂e per kg of zeatin. However, biotechnological production using a fermentation approach could be much lower at 1–4 kg CO₂e per kg zeatin. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
208 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.45 X 1000 |
Calculated |
- |
|
|
0.16 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature: substance rapidly degrades in soil |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 1000 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
10 |
Worst case of temperate acute and chronic fish |
|
|
10 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Not classified as hazardous |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
zeatin |
|
|
zeatine |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
16/05/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Tzilivakis, J., Lewis, K.A., Green, A. and Warner, D.J. (2026) A decade of growth and impact of the Pesticide Properties Database (PPDB). Human and Ecological Risk Assessment: An International Journal, 1–26. DOI: 10.1080/10807039.2026.2702066
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242
|
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database Conditions of use.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.