| L-ascorbic acid |

Last updated: 11/03/2026
|
 |
(Also known as: Vitamin C; ascorbic acid; 3-oxo-1-gulofuranolactone) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
Substance with fungicide and bactericide action against a range of crop diseases |
|
|
Late blight (Phytophthora infestans); Wilts (fusarium spp.); Grey mold (Botrytis spp.) |
|
|
Potatoes; Tomatoes; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Withdrawn |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Netherlands |
|
|
- |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Ascorbic acid exists as two enantiomers commonly referred to as L-ascorbic acide and D-ascorbic acid. The L-isomer is the more common. |
|
|
C₆H₈O₆ |
|
|
C(C(C1C(=C(C(=O)O1)O)O)O)O |
|
|
C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
|
|
CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
|
|
InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| L-ascorbic acid |
- |
 |
| L-ascorbic acid |
- |
 |
|
|
Fungicide; Other substance |
|
|
Bactericide; Biocide |
|
|
Plant-derived substance |
|
|
>990 g kg⁻¹ |
|
|
EU dossier - methanol <3g kg⁻¹; heavy metals 0.01g kg⁻¹ |
|
|
Natural |
|
|
Systemic, protective, stimulates the natural defence mechanisms and wound healing processes in plants |
|
|
A naturally occurring substance that can be isolated from synergistic vitamin C complexes found in living nutrient sources particularly citrus fruits, tomatoes and tomato juice, and potatoes |
|
|
Crop protection |
|
|
- |
|
|
50-81-7 |
|
|
200-066-2 |
|
|
774 |
|
|
- |
|
|
- |
|
|
176.1 |
|
|
- |
|
|
(5R)-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one |
|
|
- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
Some applications may be approevd under the GB Biocide Products Regulations |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
NC |
|
|
- |
|
|
White powder |
|
|
|
|
|
Current |
|
|
18th Centuary, discovered; 2011, introduced as pesticide |
|
|
|
|
|
|
|
|
Usually supplied as a soluble liquid |
|
|
L-ascorbic acid is produced commercially through a multi-step process that typically begins with glucose derived from corn starch. The most established method is the Reichstein process, which involves the hydrogenation of D-glucose to D-sorbitol, followed by microbial fermentation to L-sorbose. This is then chemically oxidised to form 2-keto-L-gulonic acid (2-KLG), which undergoes cyclization to yield L-ascorbic acid. More recently, a two-step fermentation method has gained popularity. This biotechnological approach bypasses some chemical steps, relying more on engineered microbes to convert sorbitol directly into 2-KLG, streamlining the process. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
330000 |
|
High |
|
|
Insoluble |
Ether |
- |
| Insoluble |
Benzene |
- |
| Insoluble |
Chloroform |
- |
| 50000 |
Propylene glycol |
- |
|
|
190 |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
190 |
|
- |
|
|
- |
- |
- |
|
|
|
1.32 X 10-02 |
Calculated |
- |
|
|
-1.88 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
2.19 X 10-02 |
|
Low volatility |
|
|
1.16 X 10-08 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
pH 6.4: max @ 265nm pH 2: max @ 245nm |
|
- |
|
|
Not surface active |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
15 |
|
Fast |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| ascorbate-2-sulphate |
- |
Human |
- |
| oxalic acid |
- |
Human |
- |
| dehydroascorbic acid |
- |
Human |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
11900 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 250 |
Gallus domesticus NOEL |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 600 |
24 plant species tested |
- |
|
|
> 600 |
24 plant species tested |
- |
|
|
|
> 4.5 |
Apis mellifera |
Moderate |
|
|
> 15.9 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.7 |
Aphidius rhopalosiphi |
Moderate |
|
|
9.1 |
Typhlodromus pyri |
Moderate |
|
|
> 17 |
Poecilus cupreus |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 2000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Low |
|
|
2000 |
Oreochromis niloticus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
4.40 |
Crassostrea gigas |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
1190 |
Worst case of acute and chronic mammals |
|
|
25 |
Worst case of acute and chronic birds |
|
|
100 |
Worst case of acute and chronic earthworms |
|
|
120 |
Worst case of non-target plants vegetative vigour and seedling emergence |
|
|
0.09 |
Worst case of contact and oral honeybees |
|
|
0.35 |
Worst case of parasitic wasps and predatory mites |
|
|
20 |
Worst case of temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
11900 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Intravenous LD₅₀ = 518 mg kg⁻¹ |
Mouse |
- |
| Subcutaneous LD₅₀ = 10000 mg kg⁻¹ |
Rat |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
100 |
|
- |
|
|
- |
- |
- |
|
|
|
Considered safe |
|
|
Considered safe |
|
|
Readily absorbed and excreted mainly in the urine in humans and via the lungs in rats and guinea pigs |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B1 B = DNA damage/repair (EFSA database) 1 = Positive ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Excessive consumption may cause diarrhoea and behavioural effects |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Health: H315, H318, H319 |
|
|
Not listed |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
L-ascorbic acid |
|
|
acide ascorbique |
|
|
- |
|
|
- |
|
|
acidum ascorbicum |
|
|
acido ascorbico |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
11/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.