| Potassium sorbate |

Last updated: 25/04/2026
|
 |
(Not known by any other names) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
Potassium sorbate is used in agriculture primarily as a natural fungicide and insecticide, especially in greenhouse and field applications |
|
|
Alternaria; Black mould (Aspergillus niger); Fusarium semitectum; cheese moulds including Penicillium roqueforti; Fruit fly (Drosophila melanogaster) |
|
|
Post-harvest treatment of various fruits, vegetables, cheeses and feeds |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a pest management agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₆H₇KO₂ |
|
|
C/C=C/C=C/C(=O)[O-].[K+] |
|
|
- |
|
|
CHHHXKFHOYLYRE-STWYSWDKSA-M |
|
|
InChI=1S/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; |
|
|
No |
|
|
Fungicide; Insecticide; Antimicrobial; Other substance |
|
|
Food & feed preservative |
|
|
Plant-derived |
|
|
- |
|
|
- |
|
|
Natural |
|
|
As a fungicide its mode of action is due to its ability to disrupt cellular processes especially under acidic conditions |
|
|
- |
|
|
Formed as the potassium salt of sorbic acid, which occurs naturally in small quantities in the fruits of various plants |
|
|
Food protection |
|
|
- |
|
|
24634-61-5 |
|
|
590-00-1 |
|
|
246-376-1 |
|
|
- |
|
|
075902 |
|
|
23676745 |
|
|
150.22 |
|
|
potassium;(2E,4E)-hexa-2,4-dienoate |
|
|
potassium;(2E,4E)-hexa-2,4-dienoate |
|
|
- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
USEPA minimum risk pesticide; USA GRAS; E202; FEMA=2921; FLAVIS=16.061 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not classified |
|
|
Not applicable |
|
|
- |
|
|
White crystalline solid with characteristic odour |
|
|
|
|
|
Current |
|
|
1995, first used as a seed treatment; 2002, used as a mould inhibitor in feed |
|
|
- Apac Chemical
- Celanese Nutrinova
- FBC Industries
- Salvi Chemical Industries Ltd.
- Biesterfeld SE, Germany
|
|
|
- Sorbistat-K
- Sorbistat Potassium
|
|
|
Often formulated as a seed treatment |
|
|
Commercial production of potassium sorbate begins with the synthetic creation of sorbic acid, typically through a chemical reaction between crotonaldehyde and ketene. Once sorbic acid is obtained, it’s neutralised with potassium hydroxide to form potassium sorbate. |
|
|
The production of potassium sorbate emits approximately 5.00 kg of CO₂ equivalent per kg of product. This figure represents the climate footprint at the factory level and includes emissions from energy use, chemical processing, and transport up to that stage. Alternative production methods, such as synthesising potassium sorbate from triacetic acid lactone using food-grade solvents have been explored for greater sustainability. These newer methods can have a carbon intensity ranging from 9.6 to 18.6 kg CO₂e/kg, depending on the process and feedstock used. |
|
|
|
|
|
|
|
|
|
|
582 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
270 |
|
- |
|
|
- |
- |
- |
|
|
|
6.46 X 10-03 |
Calculated |
- |
|
|
-2.19 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.363 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
72.6 |
|
- |
|
|
|
|
|
|
|
Biodegradable |
|
|
|
9 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature estimates soil DT₅₀ at around 9 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4920 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
492 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4920 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
No information available |
|
|
|
|
|
Incompatible with strong oxidising agents When heated to decomposition it emits toxic fumes of K2O |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Stable under ambient conditions |
|
|
|
|
|
potassium sorbate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/04/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.