Butachlor (Ref: CP 53619) |

Last updated: 13/02/2025
|
 |
(Also known as: amichlor; CP 53619; rasayanchlor) |
Butachlor is a herbicide used for pre-emergence control of annual grasses and some broad-leaved weeds. It has a moderate aqueous solubility and a low volatility. Depending on local conditions it may be moderately persistent in some soils. It is not expected to leach to groundwater. It is moderately toxic to most fauna and flora, the main exception being honeybees for which butachlor has a low toxicity. It has a moderate oral mammalian toxicity if ingested and is both a skin and eye irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide used for pre-emergence control of annual grasses and some broad-leaved weeds particularly in rice crops |
|
Barnyardgrass; Crab grass; Torpedo grass; Witchgrass; Red deadnettle |
|
Rice; Wheat; Barley; Peanuts |
|
- |
|
- |
|
circa 1970, introduced |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₇H₂₆ClNO₂ |
|
CCCCOCN(C1=C(C=CC=C1CC)CC)C(=O)CCl |
|
No data |
|
HKPHPIREJKHECO-UHFFFAOYSA-N |
|
InChI=1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3 |
|
Yes |
|
Herbicide |
|
Chloroacetanilide herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic absorbed primarily via germinating shoots. Inhibition of very long chain fatty acids (VLCFA, inhibition of cell division) |
|
23184-66-9 |
|
245-477-8 |
|
354 |
|
112301 |
|
31677 |
|
No data found |
|
311.9 |
|
N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
|
N-butoxymethyl-2-chloro-2',6'-diethylacetanilide |
|
N-(butoxymethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
|
PAN Bad Actor Chemical |
|
- |
|
K3 |
|
15 |
|
Not applicable |
|
Not applicable |
|
- |
|
Amber or light yellow oily liquid |
|
|
|
- Monsanto
- FCC
- King Tech Corp
- Makhteshim-Agan
- Pillar International
- BOC Sciences
|
|
- Machete
- Weedout
- Butanox
- Vendaval
|
|
Usually supplied as an emulsifiable concentrate or as granules. |
|
|
|
|
|
|
|
20 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
- |
- |
- |
|
-2.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
156 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
165 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
3.16 X 1004 |
Calculated |
- |
|
4.5 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.073 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
- |
- |
- |
- |
|
0.24 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
3.74 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
56 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
11.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature states DT₅₀ 4 days to 18 days (R4) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
700 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.23 |
Calculated |
Low leachability |
|
|
1.91 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
2.4 |
(Other literature Log BCF range -1.5-0.8 (R3)) |
Low potential |
|
1.7 |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4640 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
0.515 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.44 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
0.025 |
Danio rerio 30 day |
Moderate |
|
> 0.31 |
Danio rerio |
Moderate |
|
> 2.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
3.0 |
Ceriodaphnia dubia LC₅₀ |
Moderate |
|
> 0.19 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.2 |
Scenedesmus quadricauda |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
13000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
3.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Occupational exposure may occur through dermal contact |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
US EPA - likely to be human carcinogen |
|
|
|
Not expected to auto-ignite; Not highly flammable |
|
Health: H302, H317, H330 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
Limited shelf-life |
|
|
|
butachlor |
|
butachlore |
|
Butachlor |
|
butachlor |
|
butaclor |
|
butaclor |
|
- |
|
butachlor |
|
- |
|
- |
|
butachloor |
|
- |
Record last updated: |
13/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |