Amicarbazone (Ref: BAY MKH 3586) |

Last updated: 22/08/2024
|
 |
(Also known as: BAY 314666) |
Amicarbazone is a triazolone herbicide. It is highly soluble and there is a high risk of leaching to groundwater. It is volatile, non-persistent in soil but persistent in aquatic systems. It is moderately toxic to mammals and there is some risk of bioaccumulation. It is a respiratory tract and eye irritant but no other serious human health issues have been reported. It is moderately toxic to birds and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A triazolone, selective herbicide for pre- and post-emergence control of annual dicotyledonous weeds and grasses |
|
Creeping bentgrass; Kentucky bluegrass; Fescue; Ryegrass |
|
Turf including golf courses, sod farms, lawns, sports fields; Ornamentals including Christmas trees; Sugarcane |
|
- |
|
Current |
|
1988, discovered; 2005, USA first registered |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀H₁₉N₅O₂ |
|
CC(C)C1=NN(C(=O)N1N)C(=O)NC(C)(C)C |
|
No data |
|
ORFPWVRKFLOQHK-UHFFFAOYSA-N |
|
InChI=1S/C10H19N5O2/c1-6(2)7-13-15(9(17)14(7)11)8(16)12-10(3,4)5/h6H,11H2,1-5H3,(H,12,16) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
amicarbazone |
- |
 |
|
Herbicide |
|
Triazolone herbicide; Amide herbicide |
|
- |
|
- |
|
Synthetic |
|
Contact action, absorbed by foliage, photosynthesis II inhibition |
|
129909-90-6 |
|
603-373-3 |
|
799 |
|
114004 |
|
153920 |
|
No data found |
|
241.29 |
|
4-amino-N-tert-butyl-5-oxo-3-(propan-2-yl)-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide |
|
4-amino-N-tert-butyl-4,5-dihydro-3-isopropyl-5-oxo-1H-1,2,4-triazole-1-carboxamide |
|
4-amino-N-(1,1-dimethylethyl)-4,5-dihydro-3-(1-methylethyl)-5-oxo-1H-1,2,4-triazole-1-carboxamide |
|
- |
|
- |
|
C1 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
- Amicarbazone Technical
- Amicarbazone DF
- Dinamic
- Ary Herbicide
- Xonerate 2SC Herbicide
|
|
Available in a variety of formulations |
|
|
|
|
|
4600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
- |
- |
- |
|
137.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.70 X 1001 |
Calculated |
- |
|
1.23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Not applicable |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
No dissociation |
|
0.0013 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
6.78 X 10-08 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
50 |
|
Moderately persistent |
|
87 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature DT₅₀ studies range 15-87 days; field studies 18-24 days (CB3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
60 |
|
Stable |
|
- |
|
|
64 |
|
Moderately persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Mobile |
|
30 |
|
Literature Koc values range 23-44 mL g⁻¹ (Q3, CB3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.89 |
Calculated |
High leachability |
|
|
3.77 X 1000 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
N-(1,1-dimethylethyl)-4,5-dihydro-3-(1-methylethyl)-5- oxo-1H-1,2,4-triazole-1-carboxamide |
des-amino amicarbazone |
- |
- |
N-(1,1-dimethylethyl)-4,5-dihydro-4-methyl-3-(1-methylethyl)-5-oxo-1H-1,2,4-triazole-carboxamide |
N-methyl des-amino amicarbazone |
- |
- |
4-amino-2,4-dihydro-5-(1-methylethyl)-3H-1,2,4-triazol-3-one |
decarboxamide amicarbazone |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
1015 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
1965 |
Colinus virginianus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
> 24.4 |
|
Moderate |
|
Low |
|
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 120 |
Oncorhynchus mykiss |
Low |
|
7.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas growth |
Moderate |
|
- |
- |
- |
|
> 40.8 |
Daphnia magna |
Moderate |
|
< 0.252 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
110 |
Americamysis bahia |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.21 |
Lemna gibba |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
1015 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
2.24 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
May be absorbed through the skin - PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful if swallowed Possible liver toxicant |
|
|
|
No information available |
|
Health: H302, H332 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
amicarbazone |
|
- |
|
- |
|
- |
|
- |
|
amicarbazona |
|
- |
|
amikarbazon |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |