Alpha-chlorohydrin (Ref: U 5897) |

Last updated: 02/06/2024
|
 |
(Also known as: alpha,gamma-dichlorohydrin; 1,3-DCP; ACH) |
Alpha-chlorohydrin is a rodenticide that is not generally approved for use in the developed world. It has high potential for bio-concentration, moderately toxic to mammals, an eye irritant and a neurotoxin. Alpha-chlorohydrin is highly soluble in water and volatile but there is little environmental fate data available. It is highly toxic to birds but less toxic to fish. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A restricted use rodenticide for the specific control of Norwegian rats in indoor situations |
|
Norwegian rats |
|
- |
|
- |
|
Current |
|
1991, first registered USA |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Alpha-chlorohydrin is a chiral molecule. The technical material is an isomeric mixture of the S- and R- optical isomers. |
|
C₃H₇ClO₂ |
|
C(C(CCl)O)O |
|
No data |
|
SSZWWUDQMAHNAQ-UHFFFAOYSA-N |
|
InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
chlorohydrin |
Unstated isomer |
 |
|
Rodenticide, Other substance |
|
Chemiosterilant |
|
Organochloride rodenticide |
|
- |
|
- |
|
Synthetic |
|
Distrupts the reproduction ability of male rats |
|
96-24-2 |
|
202-492-4 |
|
None allocated |
|
117101 |
|
7290 |
|
No data found |
|
110.54 |
|
- |
|
3-chloro-1,2-dihydroxypropane |
|
3-chloro-1,2-propanediol |
|
PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Viscous colourless liquid |
|
|
|
|
|
|
|
Available as placeable bait packages for usse in tamper-resistance stations. Product contains 1% of the active substance. |
|
|
|
|
|
100000 |
|
High |
|
- |
- |
- |
|
-40 |
|
- |
|
Decomposes before boiling |
|
- |
|
213 |
|
- |
|
- |
- |
- |
|
|
1.41 X 10-01 |
Calculated |
- |
|
-0.85 |
|
Low |
|
|
Likely to be Soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
1.322 |
|
- |
|
- |
- |
- |
- |
|
13.0 X 10-05 |
|
Low volatility |
|
6.18 X 10-03 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Very mobile |
|
1.0 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
Likely to be soluble |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
131 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
23.7 |
Unknown species |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
2150 |
Rasbora heteromorpha |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
131 |
Rat |
Moderate |
|
2000 |
Rat |
- |
|
4.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Moderately toxic May cause pulmonary hemorrhaging & congestion Kidney and liver toxicant CLP data - suspected carcinogen |
|
|
|
Corrosive |
|
Handling: H290 Health: H301, H315, H318, H330, H351 |
|
Ib (Highly hazardous) |
|
- |
|
- |
|
- |
|
|
|
alpha-chlorohydrin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
02/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |