Benzoylprop |

Last updated: 02/02/2025
|
 |
(Not known by any other names) |
Benzoylprop is an obsolete herbicide that was once used to selectively control wild oats in a variety of crops. Very little information has been published regarding its environmental fate, ecotoxicity nor its impact on human health. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete herbicide |
|
Wild oats (Avena barbata, Avena fatua, Avena ludoviciana, Avena steri) |
|
Cereals including wheat; Field beans; Oilseed rape; Culinary mustard |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1970, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Benzoylprop is a chiral molecule |
|
C₁₆H₁₃Cl₂NO₃ |
|
CC(C(=O)O)N(C1=CC(=C(C=C1)Cl)Cl)C(=O)C2=CC=CC=C2 |
|
No data |
|
WZZRJCUYSKKFHO-UHFFFAOYSA-N |
|
InChI=1S/C16H13Cl2NO3/c1-10(16(21)22)19(12-7-8-13(17)14(18)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22) |
|
Yes |
|
Herbicide |
|
Arylalanine herbicide |
|
- |
|
- |
|
Synthetic |
|
Inhibition of lipid biosynthesis |
|
22212-56-2 |
|
No data found |
|
229 |
|
- |
|
90756 |
|
607-154-00-3 |
|
338.19 |
|
N-benzoyl-N-(3,4-dichlorophenyl)-DL-alanine |
|
N-benzoyl-N-(3,4-dichlorophenyl)-DL-alanine |
|
N-benzoyl-N-(3,4-dichlorophenyl)-DL-alanine |
|
- |
|
- |
|
K3 |
|
15 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
- |
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1200 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1200 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No futher information available |
|
|
|
No information available |
|
Health: H302 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
benzoylprop |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
02/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |