Hydroquinone |

Last updated: 17/05/2024
|
 |
(Also known as: quinol; alpha hydroquinone; hydroquinol; dihydroquinone; 1,4-dihydroxybenzene ) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Substance without pesticidal activity that is sometimes added to formulations as a stabiliser, especially for pyrethrum and allethrin |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₈H₆ |
|
C1=CC(=CC=C1O)O |
|
No data |
|
QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
|
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
hydroquinone |
- |
 |
|
Other substance |
|
Stabiliser |
|
Phenol |
|
- |
|
- |
|
Synthetic |
|
Not applicable |
|
123-31-9 |
|
204-617-8 |
|
- |
|
3233 |
|
- |
|
110.11 |
|
- |
|
hydroquinone |
|
benzene-1,4-diol |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White granular solid |
|
|
|
|
|
70000 |
|
High |
|
570000 |
Ethanol |
- |
100 |
Benzene |
- |
120000 |
Ethyl hexanol |
- |
220000 |
Ethyl acetate |
- |
|
174 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.89 X 1000 |
Calculated |
- |
|
0.59 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.33 |
|
- |
|
9.9 |
|
- |
Pka(2) 11.6 |
|
2.4 |
|
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
320 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
200 |
|
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.097 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.09 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
7.7 |
Lemna minor |
Moderate |
|
- |
- |
- |
|
0.335 |
Pseudokirchneriella subcapitata Growth |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
320 |
Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
May be absorbed into the body by inhalation, through the skin and by ingestion |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful by inhalation and ingestion Allergen May cause dermatitis IARC Group 3 carcinogen - not classifiable Kidney toxicant Blood & hematopoietic system toxicant |
|
|
|
May react with strong oxidising agents Combustable Prevent generation of dust IMDG Transport Hazard Class 6.1 |
|
- |
|
Not listed (Not listed) |
|
UN2662 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
hydroquinone |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
17/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |