Climbazole (Ref: 106162) |

Last updated: 24/08/2023
|
 |
(Also known as: P64; BAY MEB 6401) |
Climbazole is a fungicide used mainly for personal care products. It has a low aqueous solubility and can be persistent in soil systems. Based on its physico-chemical properties it would not be expected to leach to groundwater. Not a great deal is known about its ecotoxicity but it is moderately toxic to fish and honeybees. Climbazole has a moderate mammalian toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A topically applied antifungal agent and as a preservative in some personal care products. No known agricultural uses. |
|
Fungal and bacterial infections including dandruff; Fungi & mould formation |
|
Human skin; Household items; Buildings |
|
- |
|
Considered obsolete but may be available in some countries |
|
- |
|
Not applicable |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Climbazole is a chiral molecule. The technical material is an isomeric mixture of the R- and S-forms. |
|
C₁₅H₁₇ClN₂O₂ |
|
CC(C)(C)C(=O)C(N1C=CN=C1)OC2=CC=C(C=C2)Cl |
|
No data |
|
OWEGWHBOCFMBLP-UHFFFAOYSA-N |
|
InChI=1S/C15H17ClN2O2/c1-15(2,3)13(19)14(18-9-8-17-10-18)20-12-6-4-11(16)5-7-12/h4-10,14H,1-3H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
climbazole |
- |
 |
|
Fungicide, Other substance |
|
Preservative, Biocide |
|
Conazole fungicide |
|
>95% |
|
Various reported - chlorophenol, xylenes, hexane, cyclohexane, octane |
|
Synthetic |
|
Systemic with protective and curative action. Sterol demethylation inhibitor. |
|
38083-17-9 |
|
253-775-4 |
|
None allocated |
|
Not listed |
|
37907 |
|
No data found |
|
292.76 |
|
rac-(1R)-1-(4-chlorophenoxy)-1-(1H-imidazol-1-yl)-3,3-dimethylbutan-2-one |
|
(RS)-1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
|
1-(4-chlorophenoxy)-1-(imidazol-1-yl)-3,3 dimethylbutan-2-one |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
3 |
|
- |
|
Solid powdery substance, white to pale brown in colour |
|
|
|
|
|
- Baypival, Baysan, Crinipan AD
|
|
- |
|
|
|
|
|
8.28 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
Miscible |
Isopropanol |
- |
Miscible |
Cyclohexane |
- |
550 |
Benzyl alcohol |
- |
|
96.8 |
|
- |
|
412 |
|
- |
|
- |
- |
- |
|
212 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
5.75 X 1003 |
Calculated |
- |
|
3.76 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.76 |
|
- |
|
7.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
Max at 276nm and 283nm |
|
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
300 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Reported to be persistent especially in bio-solid amended soils |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-mobile |
|
5754 |
|
Calculated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.59 |
Calculated |
Low leachability |
|
|
1.18 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low risk |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
400 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
1.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
15.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Salvelinus confluentus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
400 |
Rat |
Moderate |
|
5000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not metabolized and excreted only slowly from the body in the urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
May cause hyperventilation and/or low blood pressure Harmful if swallowed Risk of serious damage to eyes |
|
|
|
IMDG Transport Hazard Class 9 |
|
Health: H302 Environment: H400, H410 |
|
Not listed (Not listed) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
climbazole |
|
climbazole |
|
- |
|
- |
|
- |
|
climbazol |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
24/08/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |