Florpyrauxifen (Ref: X11438848) |

Last updated: 05/02/2025
|
 |
(Also known as: XDE 848 acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide, usually used as the benzyl derivative, with various applications including as a rice weed herbicide particularly in Australia |
|
Grass weeds including barnyard grass; Sedges; Broadleaf weeds including water plantain, starfruit, arrowhead, jerry jerry and dirty Dora |
|
Rice |
|
Shown to be highly effective in research studies |
|
Current |
|
2016, introduced |
|
Approved as the benzyl derivative |
|
24/07/2029 |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Italy |
|
24/07/2029 |
|
No |
|
Yes as the benzyl derivative |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
✓ |
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₃H₈Cl₂F₂N₂O₃ |
|
COC1=C(C=CC(=C1F)C2=NC(=C(C(=C2F)N)Cl)C(=O)O)Cl |
|
- |
|
XFZUQTKDBCOXPP-UHFFFAOYSA-N |
|
InChI=1S/C13H8Cl2F2N2O3/c1-22-12-5(14)3-2-4(7(12)16)10-8(17)9(18)6(15)11(19-10)13(20)21/h2-3H,1H3,(H2,18,19)(H,20,21) |
|
Yes |
|
Herbicide, Metabolite |
|
Soil, Surface water; Sediment, Groundwater |
|
Pyridine herbicide; Picolinic acid herbicide |
|
- |
|
- |
|
Synthetic |
|
- |
|
943832-81-3 |
|
No data found |
|
990 |
|
- |
|
67420724 |
|
No data found |
|
349.10 |
|
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
|
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
|
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylic acid |
|
- |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradeable |
|
|
39.8 |
|
Moderately persistent |
|
39.8 |
|
Moderately persistent |
|
- |
- |
- |
|
131.3 |
|
Persistent |
|
- |
- |
- |
|
10.6 |
mean flooded paddy soil |
- |
|
EU 2017 dossier lab studies DT₅₀ range 28-54 days, DT₉₀ range 92-178 days, Soils =4; Flooded paddy soil DT₅₀ range 7-10 days, DT₉₀ range 23-33 days, Soils=2 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
5.8 |
|
Fast |
|
5.4 |
|
Moderately fast |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
1.83 |
|
Moderately mobile |
|
105.2 |
|
EU 2017 dossier Kd range 0.292-3.915 mL g⁻¹, Koc range 37.8-301.1 mL g⁻¹, Soils=12 |
|
|
1.35 |
|
Moderately mobile |
|
77.1 |
|
0.86 |
|
EU 2017 dossier Kf range 0.26-2.54 mL g⁻¹, Kfoc range 30.3-195.5 mL g⁻¹, 1/n range 0.82-0.89, Soils=12 |
|
Yes - increased sorption in acid soils |
|
|
|
|
|
3.38 |
Calculated |
High leachability |
|
|
4.69 X 10-01 |
Calculated |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 500 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
213 |
Eisenia foetida 56 day |
Low |
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
Dose: 0.093 & 0.467 mg kg⁻¹ soil 28 Day |
- |
|
|
- |
- |
- |
|
25 |
Folsomia candida |
- |
|
1.2 |
Carrot Vegetative vigour, ER₅₀ as g ha⁻¹ |
- |
- |
- |
- |
|
|
> 100 |
Apis mellifera as benzyl variant |
Low |
|
> 105.4 |
Apis mellifera as benzyl variant |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 91.8 |
Daphnia magna |
Moderate |
|
25 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
57.0 |
Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 500 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.5 |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
0.13 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Readily eliminated via urine and faeces |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No information available |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
florpyrauxifen |
|
florpyrauxifene |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
05/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |