Sodium monofluoroacetate |

Last updated: 13/02/2025
|
 |
(Also known as: SFA; Compound 1080; sodium fluoroacetate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A highly toxic rodenticide and vertebrate control substance with some insecticidal properties and which is chemically and toxicologically identical to the fluoroacetate found in some toxic plants |
|
Rats, Mice, Possums, Ground squirrels, Rabiits |
|
- |
|
- |
|
Current |
|
1940s first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
NaFC₂H₂O₂ |
|
C(C(=O)[O-])F.[Na+] |
|
- |
|
JGFYQVQAXANWJU-UHFFFAOYSA-M |
|
InChI=1S/C2H3FO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
|
Yes |
|
Rodenticide |
|
Organofluoride rodenticide |
|
- |
|
- |
|
Synthetic (monofluoroacetate can occur in some plants) |
|
Following absorption, intracellular conversion an animal produces fluorocitrate, which inhibits energy production in the tricarboxylic acid (Krebs) cycle |
|
62-74-8 |
|
200-548-2 |
|
- |
|
075003-4 |
|
- |
|
607-169-00-5 |
|
100.02 |
|
- |
|
sodium 2-fluoroacetate |
|
sodium monofluoroacetate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Fine, white, odourless powder |
|
|
|
- Tull Chemicals, Alabama USA
|
|
|
|
- |
|
|
|
|
|
1110000 |
|
High |
|
14000 |
Ethanol |
- |
5000 |
Methanol |
- |
49 |
Carbon tetrachloride |
- |
400 |
Acetone |
- |
|
- |
- |
- |
|
- |
- |
- |
|
200 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
10 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature suggests that substance may be metabolised by soil micro-organisms in 1-2 weeks in favourable conditions e.g. temp 11-20 °C and 8-15% moisure. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
fluoroacetate |
- |
- |
- |
fluorocitrate |
- |
Animal |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
1.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
9.11 |
Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 970 |
Lepomis macrochirus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 301 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
1.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Highly toxic by ingestion, inhalation and skin absorption CNS effects include tremulousness, hallucinations, convulsions, and respiratory depression Possible thyroid and kidney toxicant |
|
|
|
Hygroscopic Corrosive IMDG Transport Hazard Class 6.1 |
|
- |
|
Not listed (Not listed) |
|
UN2629 |
|
Packaging Group I (great danger) |
|
- |
|
|
|
sodium monofluoroacetate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
13/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |