Azinphos-methyl |

Last updated: 23/01/2025
|
 |
(Also known as: azinphosmethyl; metiltriazotion; cotnion methyl; gusathion methyl) |
Azinphos-methyl is an organophosphate insecticide. It has a moderate aqueous solubility, is volatile and not expected to leach to groundwater. It is generally not persistent in soil or water systems. Azinphos-methyl is highly toxic to mammals but is not expected to bioaccumulate. It is a neurotoxicant and an acetyl cholinesterase inhibitor. It is highly toxic to birds, honeybees and most aquatic life. It is moderately toxic to earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An organophosphorus insecticide for the control of sucking and chewing pests |
|
Mites, Ticks, Aphids; Slugs; Snails |
|
Lowland rice; Fruit; vegetables; Tobacco; Nuts; Ornamentals |
|
- |
|
Current |
|
1955, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Germany |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀H₁₂N₃O₃PS₂ |
|
COP(=S)(OC)SCN1C(=O)C2=CC=CC=C2N=N1 |
|
No data |
|
CJJOSEISRRTUQB-UHFFFAOYSA-N |
|
InChI=1S/C10H12N3O3PS2/c1-15-17(18,16-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
azinphos-methyl |
- |
 |
|
Insecticide, Acaricide, Molluscicide |
|
Organophosphate Insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic, contact and stomach action. Acetylcholinesterase (AchE) inhibitor |
|
86-50-0 |
|
201-676-1 |
|
37 |
|
058001 |
|
2268 |
|
015-039-00-9 |
|
317.32 |
|
O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] phosphorodithioate |
|
S-3,4-dihydro-4-oxo-1,2,3-benzotriazin-3-ylmethyl O,O-dimethyl phosphorodithioate |
|
O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] phosphorodithioate |
|
Potential groundwater contaminant; Severe Marine Pollutant; Chemical subject to PIC regulations; PAN Bad Actor Chemical; Subject to the provisions of the UK Poisons Act 1972 |
|
UK statutory standard for protection of inland, coastal and territorial waters for aquatic life 0.01 µg l⁻¹ as annual average |
|
Not applicable |
|
Not applicable |
|
1B |
|
Not applicable |
|
Predatory mites, Aphids, Lacewings, Codling moth, Leaf miners, plus others |
|
White crystals |
|
|
|
|
|
- Makhteshim Agan
- General Quimica S.A.
- Bayer
- Mobay
|
|
- Gusathion M
- Co-thion
- Azinpaz
- Carfene
- Guthion
|
|
Usually supplied as concentrate suspensions, liquids and wettable powders |
|
|
|
|
|
|
|
28 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
250000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
250000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
170000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
1200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Heptane |
- |
|
73 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
Decomposes before boiling |
|
- |
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
9.12 X 1002 |
Calculated |
- |
|
2.96 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.52 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
Weak acid |
|
5.00 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
5.70 X 10-06 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradable |
|
|
10 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
31 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
8.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 1.0-30.0 days, 8 field crops, various matrices, n=11; Apples & lemons in cold storage RL₅₀ range 46-122 days |
|
|
8.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 4.0-16.0 days, 6 field crops, various matrices, n=6 |
|
|
3 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately fast |
|
- |
|
|
50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
DT₅₀ 87 days at pH 4, 4 days at pH 9 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
10.9 |
|
Slightly mobile |
|
1112 |
|
EU dossier Kd range 3.33-28.5 mL g⁻¹, Koc range 425-1282 mL g⁻¹, Soils=10 |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
No |
|
|
|
|
|
1.42 |
Calculated |
Low leachability |
|
|
3.40 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
40 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
16 |
Rat |
High |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
- |
|
5 |
- |
|
- |
- |
- |
|
32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
59 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
0.42 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
[The residual time to 25% mortality (RT25) value for honeybees is 312 hrs - USEPA data] |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
> 39.3 |
Chrysoperla carnea Larva |
- |
|
- |
- |
- |
|
Harmful at dose 300 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
0.00017 |
Pimephales promelas |
High |
|
> 0.0091 |
Danio rerio |
High |
|
0.0011 |
Daphnia magna |
High |
|
0.0004 |
Daphnia magna LOEC |
High |
|
- |
- |
- |
|
0.00022 |
Americamysis bahia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
7.15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
16 |
Rat |
High |
|
175 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Eliminated in faeces and urine of mammals within 2 days of administration. |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
IMDG Transport Hazard Class 6.1 Not expected to auto-ignite; Not highly flammable |
|
Health: H300, H311, H317, H330 Environment: H400, H410 |
|
Ib (Highly hazardous) |
|
UN2783 |
|
- |
|
- |
|
|
|
azinphos-methyl |
|
azinphos-methyle |
|
Azinphos-methyl |
|
azinphos-methyl |
|
azinfos-metile |
|
azinfos-metil |
|
azinphos-methyl |
|
azinofos metylowy |
|
azinfosmetyl |
|
azinphos-metil |
|
azinfos-methyl |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |