Barban (Ref: A-980) |

Last updated: 23/01/2025
|
 |
(Also known as: barbamate; carbyne; carbine; CBN; chlorinate) |
Barban is an obsolete post-emergence carbonate herbicide. It has a moderate aqueous solubility, is volatile and would not normally be expected to leach to groundwater. It is not persistent in soiI systems and is unlikely to be persistent in water systems. It has a moderate mammalian toxicity with a low potential for bioaccumulation. There are gaps in biodiversity toxicity data but it is reported to be moderately toxic to most aquatic species. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete, a post-emergent, selective herbicide for control of wild oats and other grasses |
|
Wild oats; Canary grass; Italian ryegrass; Blackgrass |
|
Cereals, particular barley, wheat; Sugarbeet; Beans & peas; Flax; Lentils; Beet crops including mangolds; Some soft fruit |
|
- |
|
Considered obsolete but may be available in some countries |
|
1958, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₉Cl₂NO₂ |
|
C1=CC(=CC(=C1)Cl)NC(=O)OCC#CCCl |
|
No data |
|
MCOQHIWZJUDQIC-UHFFFAOYSA-N |
|
InChI=1S/C11H9Cl2NO2/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,(H,14,15) |
|
Yes |
|
Herbicide |
|
Carbamate ester herbicide; Carbanilate herbicide |
|
- |
|
- |
|
Synthetic |
|
Herbicidal action is due to anti-mitotic effects, reducing plant cellular division and so retarding shoot growth. Inhibition of microtubule organisation. |
|
101-27-9 |
|
202-930-4 |
|
134 |
|
017601 |
|
7551 |
|
006-020-00-6 |
|
258.10 |
|
4-chlorobut-2-yn-1-yl (3-chlorophenyl)carbamate |
|
4-chlorobut-2-ynyl 3-chlorocarbanilate |
|
4-chloro-2-butynyl (3-chlorophenyl)carbamate |
|
- |
|
- |
|
K2 |
|
23 |
|
Not applicable |
|
Not applicable |
|
- |
|
Solid |
|
|
|
|
|
- Neoban
- Fisons B25
- Carbyne
- Dualweed
|
|
No longer available |
|
|
|
|
|
11.0 |
|
Moderate |
|
327000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Benzene |
- |
113000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source n-Butylbenzene |
- |
257000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Toluene |
- |
279000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Xylene |
- |
|
75 |
|
- |
|
- |
- |
- |
|
224 |
|
- |
|
- |
- |
- |
|
|
2.57 X 1003 |
Calculated |
- |
|
3.41 |
|
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.39 |
|
- |
|
- |
- |
- |
- |
|
0.05 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Low volatility |
|
1.17 X 10-03 |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
5 |
|
Non-persistent |
|
- |
- |
- |
|
9.5 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Field studies literature values DT₅₀ range 4-15 days; Other general literature 1-60 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.05 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
pH sensitive: 1.1 hours at pH7, 7 mins at pH8 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
1000 |
|
Other sources: Koc 1200 mL g⁻¹ estimate (CA2) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.98 |
Calculated |
Low leachability |
|
|
1.28 X 10-02 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
2.2 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
527 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.53 |
Cyprinus carpio |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.30 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
10.0 |
Chlorella pyrenoidosa |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
527 |
Rat |
Moderate |
|
1600 |
Rabbit |
- |
|
27.4 |
Rabbit 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
General population exposure should be low or non-existent since barban is no longer produced or used |
|
Occupational exposure should be low or non-existent since barban is no longer produced or used |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
May cause contact dermatitis Potential immunosuppressant |
|
|
|
IMDG Transport Hazard Class 6,1 |
|
Health: H302, H317 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2757 |
|
- |
|
- |
|
|
|
barban |
|
barbane |
|
Barban |
|
- |
|
- |
|
Barban |
|
- |
|
barban |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |