Chlorfenprop-methyl |

Last updated: 23/01/2025
|
 |
(Also known as: BAY 70533; Bayer 70533) |
Chorfenprop-methyl is an obsolete herbicide that was mainly used for controlling wild oats in winter cereals. It has a moderate aqueous solubility and is highly volatile. It is highly toxic to aquatic organisms. It is moderately toxic to mammals if ingested and is a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A graminicide effective at controlling wild oats but now obsolete |
|
Wild oats |
|
Winter cereals; Rice; Potatoes |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1973, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. The technical material is an isomeric mixture of the d(+)- and l(-)-siomers. The l(-) enantiomer is much more biologically active than the d(+)-form. |
|
C₁₀H₁₀Cl₂O₂ |
|
COC(=O)C(CC1=CC=C(C=C1)Cl)Cl |
|
No data |
|
YJKIALIXRCSISK-UHFFFAOYSA-N |
|
InChI=1S/C10H10Cl2O2/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |
|
Yes |
|
Herbicide |
|
Unclassified herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, basic metabolic processes become inactivated during autolysis |
|
14437-17-3 |
|
238-413-5 |
|
270 |
|
557200 |
|
26693 |
|
No data found |
|
233.09 |
|
rac-methyl (2R)-2-chloro-3-(4-chlorophenyl)propanoate |
|
methyl (RS)-2-chloro-3-(4-chlorophenyl)propionate |
|
methyl α,4-dichlorobenzenepropanoate |
|
- |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
Colourless to brown liquid |
|
|
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate |
|
|
|
|
|
40.0 |
at 25 °C |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
300 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
122 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
2.82 X 1003 |
Calculated |
- |
|
3.45 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.28 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
930 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 1000 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.0027 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.0091 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1000 |
Rat |
Moderate |
|
756 |
Rat |
- |
|
1.3 |
Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Moderately toxic by ingestion, inhalation and skin contact |
|
|
|
IMDG Transport Hazard Class 6.1 |
|
Health: H302, H312 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2810 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
chlorfenprop-methyl |
|
chlorfenprop-methyl |
|
Chlorfenprop-methyl |
|
- |
|
- |
|
clorfenprop-metil |
|
- |
|
chlorofenprop metylowy |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |