Dikegulac |

Last updated: 05/02/2024
|
 |
(Also known as: diprogulic acid; dikegulac acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Growth retardant for woody plants, usually used as the sodium salt |
|
Apical dominance in plant shoots |
|
Citrus; Deciduous, evergreen and conifer trees including chistmas trees; Ornamentals including begonia, fushia, petunia, verbena, oleander, viburnum |
|
- |
|
Current |
|
circa 1975, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Dikegulac is a chiral molecule |
|
C₁₂H₁₈O₇ |
|
CC1(OCC2C(O1)C3C(O2)(OC(O3)(C)C)C(=O)O)C |
|
CC1(OC[C@H]2[C@@H](O1)[C@H]3[C@@](O2)(OC(O3)(C)C)C(=O)O)C |
|
FWCBATIDXGJRMF-FLNNQWSLSA-N |
|
InChI=1S/C12H18O7/c1-10(2)15-5-6-7(17-10)8-12(16-6,9(13)14)19-11(3,4)18-8/h6-8H,5H2,1-4H3,(H,13,14) |
|
Yes |
|
Plant Growth Regulator |
|
Unclassified pesticide |
|
- |
|
- |
|
Synthetic |
|
Decreases RNA synthesis, rapidly inhibits amino-acid uptake by cells |
|
18467-77-1 |
|
242-348-8 |
|
None allocated |
|
- |
|
65420 |
|
No data found |
|
274.27 |
|
2,3:4,6-di-O-isopropylidene-a-L-xylo-2-hexulofuranosonic acid |
|
2,3:4,6-di-O-isopropylidene-α-L-xylo-2-hexulofuranosonic acid |
|
2,3:4,6-bis-O-(1-methylethylidene)-α-L-xylo-2-hexulofuranosonic acid |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White to off-white odourless powder |
|
|
|
|
|
|
|
20000 |
|
High |
|
- |
- |
- |
|
92 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
2.00 X 1000 |
Calculated |
- |
|
0.301 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.28 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
2.7 |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
15 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
- |
|
Very mobile |
|
10 |
|
- |
|
- |
|
- |
|
|
|
|
|
3.53 |
Calculated |
High leachability |
|
|
2.70 X 10-01 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Very mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 19000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 50000 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 81.0 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 5000 |
Cyprinus carpio |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 10000 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
9.6 |
Lemna minor |
Moderate |
|
- |
- |
- |
|
60.0 |
Chlorella vulgaris |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 19000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Workers should not re-enter sprayed area for minimum of 12hrs. PPE/PPC required |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful if inhaled |
|
|
|
No information available |
|
- |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
dikegulac |
|
- |
|
Dikegulac |
|
- |
|
- |
|
- |
|
- |
|
dikegulak |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
05/02/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |