Isoprocarb (Ref: OMS 32) |

Last updated: 22/08/2024
|
 |
(Also known as: MIPC; ENT 25670) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Used to control a variety of sucking and chewing insects including on rice, vegetables and other crops |
|
Leaf hoppers; Aphids; Capsids; Plant hoppers |
|
Rice; Cocoa; Sugarcane; Vegetables; Cotton |
|
- |
|
- |
|
1967, registered Japan |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₁₅NO₂ |
|
CC(C)C1=CC=CC=C1OC(=O)NC |
|
- |
|
QBSJMKIUCUGGNG-UHFFFAOYSA-N |
|
InChI=1S/C11H15NO2/c1-8(2)9-6-4-5-7-10(9)14-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
|
Yes |
|
Insecticide |
|
Carbamate insecticide; Phenyl methylcarbamate insecticide |
|
- |
|
- |
|
Synthetic |
|
Contact and stomach action. Acetylcholinesterase (AChE) inhibitor. |
|
2631-40-5 |
|
220-114-6 |
|
392 |
|
512300 |
|
17517 |
|
006-053-00-6 |
|
193.24 |
|
2-(propan-2-yl)phenyl methylcarbamate |
|
o-cumenyl methylcarbamate |
|
2-(1-methylethyl)phenyl methylcarbamate |
|
Marine Pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
Nilaparvata lugens, Plutella xylostella |
|
Colourless crystals |
|
|
|
|
|
|
|
270 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
1500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
65000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
290000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
180000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
|
92.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.09 X 1002 |
Calculated |
- |
|
2.32 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.04 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
2.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
0.002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
11.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature gives DT₅₀ 3-20 days for paddy fields |
|
|
- |
- |
- |
|
- |
|
|
1.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Published literature RL₅₀ range 0.7-3.8 days, 2 crops field & undercover, n=3 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
|
Low mobility |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
403 |
Rat |
Moderate |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
> 300 |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 2.82 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 2.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 22.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Moderate |
|
0.018 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Carassius auratus 15 day |
Moderate |
|
- |
- |
- |
|
0.024 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 21.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Low |
|
0.2 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pseudokirchneriella subcapitata Growth |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
403 |
Rat |
Moderate |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
2.09 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat (aerosol) |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Harmful if swallowed |
|
|
|
IMDG Transport Hazard Class 6,1 |
|
Health: H302 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2757 |
|
- |
|
- |
|
|
|
isoprocarb |
|
isoprocarbe |
|
Isoprocarb |
|
- |
|
- |
|
isoprocarb |
|
- |
|
izoprokarb |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |