Nitralin (Ref: HSDB 789) |

Last updated: 23/08/2024
|
 |
(Also known as: nitraline; planavin; SD 11831) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Largely obsolete herbicide that was used to control annual weeds on a variety of crops including vines. |
|
Annual grass weeds; Annual broad-leaved weeds |
|
Vines; Soybeans; Cotton; Beans; Groundnuts; Sunflowers; Tobacco |
|
- |
|
Considered obsolete but may be available in some countries |
|
1966, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₃H₁₉N₃O₆S |
|
CCCN(CCC)C1=C(C=C(C=C1[N+](=O)[O-])S(=O)(=O)C)[N+](=O)[O-] |
|
- |
|
UMKANAFDOQQUKE-UHFFFAOYSA-N |
|
InChI=1S/C13H19N3O6S/c1-4-6-14(7-5-2)13-11(15(17)18)8-10(23(3,21)22)9-12(13)16(19)20/h8-9H,4-7H2,1-3H3 |
|
Yes |
|
Herbicide |
|
Dinitroaniline herbicide |
|
>94% |
|
- |
|
Synthetic |
|
Microtubular assembly inhibitor, selective |
|
4726-14-1 |
|
225-219-0 |
|
561 |
|
037601 |
|
20848 |
|
No data found |
|
345.37 |
|
4-(methanesulfonyl)-2,6-dinitro-N,N-dipropylaniline |
|
4-mesyl-2,6-dinitro-N,N-dipropylaniline |
|
4-(methylsulfonyl)-2,6-dinitro-N,N-dipropylbenzenamine |
|
- |
|
- |
|
K1 |
|
3 |
|
Not applicable |
|
Not applicable |
|
- |
|
Yellow solid |
|
|
|
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
0.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source at 22 °C |
Low |
|
360000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
150 |
|
- |
|
Decomposes before boiling |
|
- |
|
225 |
|
- |
|
- |
- |
- |
|
|
8.32 X 1002 |
Calculated |
- |
|
2.92 |
|
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
81 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
81 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
77.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other literature quotes 30-50 days (L3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
100 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.78 |
Calculated |
High leachability |
|
|
9.02 X 10-01 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
22.0 |
Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.002 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
Slightly toxic |
|
|
|
No information available |
|
Health: H302 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
nitralin |
|
nitralin |
|
Nitralin |
|
- |
|
nitralin |
|
nitralina |
|
- |
|
- |
|
- |
|
nitralin |
|
- |
|
- |
Record last updated: |
23/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |