2-(thiocyanomethylthio)benzothiazole |

Last updated: 29/01/2025
|
 |
(Also known as: TCMTB; TCMB; alentisan; KVK 733059) |
2-(thiocyanomethylthio)benzothiazole is a soil and seed treatment used to control various fungal and bacterial infections. It is moderately soluble in water, has a low volatility and is not expected to be persistent in soil systems. It is not expected to leach to groundwater. It has a pungent odour, is highly toxic to most aquatic species and moderately toxic to birds. 2-(thiocyanomethylthio)benzothiazole is highly toxic to humans via the oral route and is a recognised irritant. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Used as a soil and seed treatment against various diseases. Also used as a marine biocide, and as a wood and leather preservative. |
|
Mildews; Moulds; Bacterial blight; Bacterial slime; Basal rot; Brown rot; Damping off; Kernal smut; Bunt |
|
Cereals including barley, wheat, oats; Ornamentals; Cotton, Rice; Legumes; Sorghum; Sugar beet |
|
- |
|
Current |
|
1980, introduced USA |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₆N₂S₃ |
|
C1=CC=C2C(=C1)N=C(S2)SCSC#N |
|
- |
|
TUBQDCKAWGHZPF-UHFFFAOYSA-N |
|
InChI=1S/C9H6N2S3/c10-5-12-6-13-9-11-7-3-1-2-4-8(7)14-9/h1-4H,6H2 |
|
Yes |
|
Fungicide, Other substance |
|
Biocide, Wood preservative, Microbiocide |
|
Mercaptobenzothiazole fungicide; Mercaptobenzothiazole biocide |
|
- |
|
- |
|
Synthetic |
|
Complex - reacts with the nucleophilic cell entities which causes the antimicrobial activity. Also known to inhibit flavoenzymes in the tricarboxylic acid cycle. |
|
21564-17-0 |
|
244-445-0 |
|
None allocated |
|
035603 |
|
30692 |
|
613-119-00-3 |
|
238.36 |
|
1,3-benzothiazol-2-ylsulfanyl)methyl]sulfanyl}carbonitrile |
|
2-(thiocyanatomethylthio)-1,3-benzothiazole |
|
(2-benzothiazolylthio)methyl thiocyanate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not known |
|
- |
|
Dark orange liquid |
|
|
|
- |
|
- Busan 30
- Busan 44
- Superdavloxan
- Busan 72
|
|
Usually supplied as an emulsifiable liquid, ready-to-use liquids and wettable powders |
|
|
|
|
|
125 |
at 24 °C |
Moderate |
|
Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethyl acetate |
- |
|
- |
- |
- |
|
191 |
|
- |
|
60 |
- |
- |
|
189 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
2.00 X 1003 |
Calculated |
- |
|
3.3 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.4 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
6.58 X 10-07 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
1.4 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
|
- |
|
Stable at pH 5, slow hydrolysis at pH 7, around 2 days at pH 9 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
4089 |
|
Koc range 282 - 7896 mL g⁻¹ |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
0.06 |
Calculated |
Low leachability |
|
|
2.07 X 10-04 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
230 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Whole fish |
Threshold for concern |
|
Not available |
- |
|
|
|
|
|
Minor fraction |
- |
- |
|
Minor fraction |
- |
- |
Known groundwater metabolites |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
143 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 1310 |
Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.0021 |
Oncorhynchus mykiss |
High |
|
0.00034 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Oncorhynchus mykiss 60 day |
High |
|
- |
- |
- |
|
0.0153 |
Ceriodaphnia dubia |
High |
|
0.00089 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Daphnia magna |
High |
|
0.0056 |
Ceriodaphnia dubia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.43 |
Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
143 |
Rat |
Moderate |
|
10000 |
Rabbit |
- |
|
0.0671 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Can be absorbed into the body by inhalation of its aerosol and by ingestion |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Probably liver and kidney toxicant May damage eyes US EPA - possible human carcinogen |
|
|
|
Corrosive Combustable |
|
Health: H302, H315, H319, H330 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
2-(thiocyanomethylthio)benzothiazole |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
29/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |