Carbanolate (Ref: U12927) |

Last updated: 07/01/2024
|
 |
(Not known by any other names) |
Carbanolate is an obsolete carbamate insecticide. It has a moderate aqueous solubility. There are significant gaps in reported data for environmental fate and ecotoxicity. However, it is highly toxic to mammals and likely to bioaccumulate. It is also a neurotoxin and an acetyl cholinesterase inhibitor. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete insecticide and acaricide that was also used for the control of ectoparasites on poultry |
|
Spidermites; Stunt mites; Nematodes; Aphids |
|
Fruit; Vegetables including squash |
|
- |
|
Considered obsolete but may be available in some countries |
|
circa 1985, introduced |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₀H₁₂ClNO₂ |
|
CC1=CC(=C(C=C1C)Cl)OC(=O)NC |
|
- |
|
QRTXZGIQTYDABO-UHFFFAOYSA-N |
|
InChI=1S/C10H12ClNO2/c1-6-4-5-8(9(11)7(6)2)14-10(13)12-3/h4-5H,1-3H3,(H,12,13) |
|
Yes |
|
Insecticide, Acaricide, Veterinary substance |
|
Carbamate insecticide; Carbamate acaricide; Phenyl methylcarbamate insecticide |
|
- |
|
- |
|
Synthetic |
|
Acetylcholine esterase inhibitor |
|
671-04-5 |
|
No data found |
|
None allocated |
|
219100 |
|
522251 |
|
No data found |
|
213.66 |
|
2-chloro-4,5-dimethylphenyl methylcarbamate |
|
6-chloro-3,4-xylyl methylcarbamate |
|
2-chloro-4,5-dimethylphenyl methylcarbamate |
|
PAN Bad Actor Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
- |
|
White crystalline solid |
|
|
|
|
|
202 |
|
Moderate |
|
- |
- |
- |
|
124 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
307 |
|
- |
|
- |
- |
- |
|
139.3 |
|
- |
|
|
4.47 X 1002 |
Calculated |
- |
|
2.65 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
30.0 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
4.22 |
R4 R = Peer reviewed scientific publications 4 = Verified data median of 12 species |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
30.0 |
Rat |
High |
|
1200 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
May be rapidly absorbed through the skin with potential adverse health effects - PPE/PPC essential |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
May cause delayed adverse health effects May cause respiratory depression, mental confusion and unconsciousness May cause brain hemorrhages, and seizures at high concentrations May cause contact dermatitis |
|
|
|
IMDG Transport Hazard Class 6.1 Extinguish fires with CO2, dry powder or spray Incompatible with strong bases & strong oxidising agents Corrosive Will release toxic fumes on decomposition |
|
- |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2757 |
|
Packaging Group II (moderate danger) |
|
- |
|
|
|
carbanolate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
07/01/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |