Cycloheximide |

Last updated: 21/09/2023
|
 |
(Also known as: naramycin; U-4527; isocycloheximide ) |
Cycloheximide is an obsolete antibiotic fungicide. It is highly soluble in water and is quite mobile so there may be some risk to groundwaters depending on local conditions. It is highly toxic to birds but other ecotoxicological data is missing. It is highly toxic if ingested and may be fatal. It is also genotoxic and a reproduction/developmental toxin. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete antibiotic fungicide used in horticultural mainly in combination with other fungicides |
|
Powdery mildew; Rusts; Leafspot; Petal blight |
|
Ornamentals including roses, azaleas, lawn grass; Citrus; Olives |
|
- |
|
Considered obsolete but may be available in some countries |
|
1946, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule; Absolute stereochemistry with 4 defined stereocentres |
|
C₁₅H₂₃NO₄ |
|
CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C |
|
C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C |
|
YPHMISFOHDHNIV-FSZOTQKASA-N |
|
InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
cycloheximide |
- |
 |
|
Fungicide, Plant Growth Regulator, Antibiotic |
|
Unclassified pesticide; Dicarboximide compound |
|
- |
|
- |
|
Synthetic |
|
A protein biosynthesis inhibitor |
|
66-81-9 |
|
200-636-0 |
|
469 |
|
043401 |
|
6197 |
|
613-140-00-8 |
|
281.16 |
|
4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione |
|
4-{(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl}piperidine-2,6-dione |
|
4-((2R)-2-((1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl)-2-hydroxyethyl)-2,6-piperidinedione |
|
Subject to the provisions of the UK Poisons Act 1972 |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not known |
|
- |
|
Colourless crystalline solid |
|
|
|
|
|
- Acti-Aid
- Acti-dione
- Actispray
|
|
Usually formulated as a wettable powder or concentrated liquid |
|
|
|
|
|
21000 |
|
High |
|
70000 |
Amyl acetate |
- |
330000 |
Acetone |
- |
190000 |
Cyclohexanone |
- |
|
120 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
492 |
|
- |
|
- |
- |
- |
|
251 |
|
- |
|
|
3.55 X 1000 |
Calculated |
- |
|
0.55 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
1.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Cherry fruits, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Mobile |
|
47 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
133 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mouse |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
82.5 |
Anas platyrhynchos |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
133 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mouse |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Highly toxic Bone marrow toxicant Suspected of causing genetic defects |
|
|
|
Avoid generation of dust Gives off irritating or toxic fumes in a fire IMDG Transport Hazard Class 6.1 |
|
Health: H300, H341, H361, Environment: H411 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2811 |
|
Packaging Group 1 (great danger) |
|
- |
|
|
|
cycloheximide |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
21/09/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |