Clopyralid-olamine |

Last updated: 04/01/2025
|
 |
(Also known as: clopyralid MEA) |
Clopyralid olamine is a selective herbicide used to control weeds in turf. It is moderately persistent in the environment and, based on its physico-chemical properties, it has high potential to leach to groundwater. Clopyralid olamine tends to be low to moderately toxic to fauna and flora. It has a low mammalian toxicity as a skin, eye and respiratory irritant |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide for a post-emergent control of many broad-leaved weeds in ornamental lawns, turf, non-cropped areas and some food crops |
|
Broad-leaved weeds including thistles, dandelion, horseweed, nightshade, clover |
|
Turf and lawns; Rights of way; Cereals including wheat, barley, oats; Sugarbeet |
|
- |
|
Current |
|
- |
|
Approved (as clopyralid) |
|
30/04/2029 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved (as clopyralid) |
|
Finland/Poland |
|
30/09/2036 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
None |
|
C₈H₁₀Cl₂N₂O₃ |
|
C1=CC(=NC(=C1Cl)C(=O)O)Cl.C(CO)N |
|
- |
|
NQQBTWVFKDDVIB-UHFFFAOYSA-N |
|
InChI=1S/C6H3Cl2NO2.C2H7NO/c7-3-1-2-4(8)9-5(3)6(10)11;3-1-2-4/h1-2H,(H,10,11);4H,1-3H2 |
|
Yes |
|
Herbicide |
|
Pyridine herbicide; Picolinic acid herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, absorbed through leaves and roots. Synthetic auxin. |
|
57754-85-5 |
|
260-929-4 |
|
455 |
|
117401 |
|
162839 |
|
607-231-00-1 |
|
253.08 |
|
3,6-dichloropyridine-2-carboxylic acid with 2-aminoethanol |
|
3,6-dichloropyridine-2-carboxylic acid with 2-aminoethanol |
|
3,6-dichloro-2-pyridinecarboxylic acid, alkanolamine salt |
|
Possible groundwater contaminant; PAN Listed as Highly Hazardous Chemical |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
Commercial product is a brown coloured, odourless liquid |
|
|
|
|
|
|
|
- Lontrel 200 Herbicide
- Millennium Ultra Selective Herbicide
- Galera
- Transline
- Stinger
|
|
Usually supplied as a soluble concentrate that is mixed with water and applied as a spray. |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
100 |
E4 E = Manufacturers safety data sheets 4 = Verified data as product |
- |
|
- |
- |
- |
|
>79 |
E4 E = Manufacturers safety data sheets 4 = Verified data (closed cup) as product |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
34 |
as clopyralid |
Moderately persistent |
|
34 |
as clopyralid |
Moderately persistent |
|
11 |
as clopyralid |
Non-persistent |
|
113 |
as clopyralid |
Persistent |
|
38 |
as clopyralid |
- |
|
- |
- |
- |
|
EU dossier for clopyralid lab studies DT₅₀ range 13-65 days, DT₉₀ range 43-217 days, field studies DT₅₀ range 2-24 days, DT₉₀ range 6-79 days; Other sources: DT₅₀ 40 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
0.071 |
- |
Very mobile |
|
5.0 |
|
EU dossier for clopyralid Kd range 0.032-0.151, Koc range 3.43-7.34 mL g⁻¹, Soils=5 |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
3.44 |
Calculated |
High leachability |
|
|
1.36 X 10-01 |
Calculated |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
<1.0 |
|
Low potential |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
2675 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
1465 |
Anas platyrhynchos |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Eisenia foetida as clopyralid |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 98.1 |
as clopyralid |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 99.9 |
Oncorhynchus mykiss as clopyralid |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 99.0 |
Daphnia magna as clopyralid |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
89.0 |
Lemna gibba as clopyralid |
Low |
|
- |
- |
- |
|
6.9 |
Selenastrum capricornutum |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
2675 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.15 |
Rat SF=100 as clopyralid |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
1.0 |
as clopyralid |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Minimal risk of dietary exposure |
|
Risk of exposure acceptable under label recommendations for use for personal protection clothing and equipment |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Corrosive to ocular tissue |
|
|
|
Prevent release of dust Not explosive or oxidising |
|
Health: H318 |
|
III (Slightly hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
clopyralid-olamine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
04/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |