Broflanilide (Ref: MCI-8007) |

Last updated: 26/04/2024
|
 |
(Also known as: BAS 450 I) |
Broflanilide is an insecticide that is used to control chewing pests. It has a low aqueous solubility and is not considered to be highly volatile. In some situations it may be very persistent in soil and in water systems. Whilst it is highly toxic to honeybees, It generally tends to have a low to moderate toxicity to most other fauna and flora. It has a low oral mammalian toxicity and no other human health concerns have been identified. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A meta-diamide organo-halide insecticide that has larvicidal activity against many chewing pests |
|
Chewing insect pests including termites, roaches and Spodoptera litura; Ants; Flies; Bedbugs |
|
Corn; Industrial, commercial and residential areas |
|
- |
|
Current |
|
2020, first registration Australia |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, Canada, Mexico |
|
None |
|
C₂₅H₁₄BrF₁₁N₂O₂ |
|
CN(C1=CC=CC(=C1F)C(=O)NC2=C(C=C(C=C2Br)C(C(F)(F)F)(C(F)(F)F)F)C(F)(F)F)C(=O)C3=CC=CC=C3 |
|
- |
|
QSLZKWPYTWEWHC-UHFFFAOYSA-N |
|
InChI=1S/C25H14BrF11N2O2/c1-39(21(41)12-6-3-2-4-7-12)17-9-5-8-14(18(17)27)20(40)38-19-15(23(29,30)31)10-13(11-16(19)26)22(28,24(32,33)34)25(35,36)37/h2-11H,1H3,(H,38,40) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
broflanilide |
- |
 |
|
Insecticide, Larvicide |
|
Diamide insecticide; Meta-diamide insecticide |
|
- |
|
- |
|
Synthetic |
|
Metabolises to desmethyl-broflanilide which the acts as a noncompetitive resistant-to-dieldrin (RDL) gamma-aminobutyric acid (GABA) receptor antagonist |
|
1207727-04-5 |
|
688-148-8 |
|
994 |
|
- |
|
53341374 |
|
663.3 |
|
N-(2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl)-2-fluoro-3-(N-methylbenzamido)benzamide |
|
6'-bromo-α,α,α,2-tetrafluoro-3-(N-methylbenzamido)-4'-(1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl)benz-o-toluidide |
|
3-(benzoylmethylamino)-N-(2-bromo-4-(1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl)-6-(trifluoromethyl)phenyl)-2-fluorobenzamide |
|
This pesticide is a PFAS based on the US definition |
|
- |
|
Not applicable |
|
Not applicable |
|
30 |
|
Not applicable |
|
- |
|
White odourless powder |
|
|
|
- Mitsui Chemicals Agro Inc
- BASF
|
|
- Vedira Granular fly bait
- Vedira Gel Cockroach Bait
- Vedira Pressurised Insecticide
- Tenebenal
|
|
Available in a variety of different formultions including 'ready to use' |
|
|
|
|
|
|
|
0.71 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
96.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes n-Heptane |
- |
6000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Xylene |
- |
7400 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes n-Octanol |
- |
250000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Acetone |
- |
|
154.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.58 X 1005 |
Calculated |
- |
|
5.2 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
8.8 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
- |
|
9.0 X 10-06 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low volatility |
|
3.0 X 10-06 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
Neutral soln: 239nm=17200, 274nm=5000, 282nm=4090 Acidic soln: 239nm=17000, 274nm=4980, 282nm=4120 Basic soln: 248nm=17600, 293nm=5560 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
596 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Very persistent |
|
596 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Very persistent |
|
107 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Australian regulatory dossier: Lab studies degradation under aerobic conditions is slow. Field studies: DT₅₀ range 26-182 days. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Stable |
|
Stable at all relevant environmental pH values |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
189 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Threshold for concern |
|
0.5 |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
> 1000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Mouse |
Low |
|
> 2000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Unknown species |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 500 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Eisenia foetida corr |
Moderate |
|
> 15 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Eisenia foetida corr |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Onion ryegrass wheat corn sugarbeet oilseed rape cabbage soybean lettuce and tomato Seedling emergence, ER₅₀ as g ha⁻¹ |
- |
- |
- |
- |
|
|
0.01 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
High |
|
0.015 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
High |
|
- |
- |
- |
|
> 0.00062 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.25 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Lepomis macrochirus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.33 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Daphnia magna |
Moderate |
|
0.0058 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.63 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Lemna gibba |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
5000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Rapid elimination, 90% within 4hrs of dosing |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
No data found |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Possible ovary toxicant |
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
- |
|
Not listed (Not listed) |
|
- |
|
Not corrosive to packaging |
|
- |
|
|
|
broflanilide |
|
broflanilide |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
26/04/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |