Florylpicoxamid (Ref: X12485659) |

Last updated: 14/12/2024
|
 |
(Also known as: XDE 659; XR-659) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A 'green chemistry' fungicide derived from renewable raw materials which offers curative and protectant disease control of a wide range of pathogens in multiple crops |
|
Septoria spp, Powdery Mildews, Botrytis spp, Anthracnose, Alternaria, Scab, Monilinia and others |
|
Cereals; Vines; Fruits; Nuts; Vegetables; Oilseed rape; Sugarbeet; Lentils; Ornamentals |
|
Efficacy and crop safety was assessed in various places including Australi and new Zealand |
|
Novel |
|
2019, introduced |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Pending |
|
Denmark |
|
Not applicable |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, USA, Canada, South Korea |
|
Isomeric but purposely developed as a single stereoisomer |
|
C₂₇H₂₆F₂N₂O₆ |
|
CC(C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F)OC(=O)C(C)NC(=O)C3=NC=CC(=C3OC(=O)C)OC |
|
C[C@@H](C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F)OC(=O)[C@H](C)NC(=O)C3=NC=CC(=C3OC(=O)C)OC |
|
ATZHVIVDMUCBEY-HOTGVXAUSA-N |
|
InChI=1S/C27H26F2N2O6/c1-15(31-26(33)24-25(37-17(3)32)22(35-4)13-14-30-24)27(34)36-16(2)23(18-5-9-20(28)10-6-18)19-7-11-21(29)12-8-19/h5-16,23H,1-4H3,(H,31,33)/t15-,16-/m0/s1 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
florylpicoxamid |
- |
 |
|
Fungicide, Other substance |
|
Bactericide |
|
Picolinamide fungicide |
|
>98% |
|
- |
|
Synthetic |
|
Broad spectrum. Substance is a quinone inside inhibitor (QiI) causing disruption of the fungal mitochondrial electron transport system complex III. |
|
1961312-55-9 |
|
No data found |
|
None allocated |
|
- |
|
- |
|
No data found |
|
512.51 |
|
(1S)-2,2-bis(4-fluorophenyl)-1-methylethyl N-[(3-acetoxy-4-methoxy-2-pyridyl)carbonyl]-L-alaninate |
|
(1S)-2,2-bis(4-fluorophenyl)-1-methylethyl N-[(3-acetoxy-4-methoxy-2-pyridyl)carbonyl]-L-alaninate |
|
(1S)-2,2-bis(4-fluorophenyl)-1-methylethyl N-[[3-(acetyloxy)-4-methoxy-2-pyridinyl]carbonyl]-L-alaninate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
21 |
|
None identified |
|
Fine, off-white coloured powder |
|
|
|
- Dow AgroSciences LLC
- Corteva Agriscience
|
|
|
|
Usually supplied as an emulsifiable concentrate formulation |
|
|
|
|
|
|
|
4.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
250000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Methanol |
- |
250000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Acetone |
- |
190 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes n-Heptane |
- |
250000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Ethyl acetate |
- |
|
91 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
Decomposes before boiling |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
150 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
- |
- |
- |
|
|
1.58 X 1004 |
Calculated |
- |
|
4.2 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.28 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
- |
- |
- |
- |
|
5.0 X 10-03 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low volatility |
|
6.0 X 10-06 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
Max at 265nm & 271nm |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
185 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Persistent |
|
2.5 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Australian Dossier 2022: Lab studies DT₅₀ (normalised) range 99-287 days, Field studies: DT₅₀ (measured) range 1.7-4.1 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
0.12 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Fast |
|
- |
|
|
17 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
pH sensitive: 13 days at pH4; 0.33 days at pH9 |
|
- |
- |
- |
|
31 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Stable |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
|
- |
|
|
22 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Slightly mobile |
|
1299 |
|
0.89 |
|
Australian dossier 2022: Kf range 13-43 mL g⁻¹, Kfoc range 1453-26372 mL g⁻¹ |
|
- |
|
|
|
|
|
0.35 |
Calculated |
Low leachability |
|
|
9.70 X 10-04 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
|
|
|
|
Major fraction |
0.930 |
- |
|
Major fraction |
0.330 |
- |
|
Major fraction |
0.120 |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 3.3 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Eisenia andrei corr |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 134 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Solanum lycopersicum Vegetative vigour ER25 as g ha⁻¹ |
- |
> 300 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes ten species tested Seedling emergence ER25 as g ha⁻¹ |
- |
|
|
> 100 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
Low |
|
> 108 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
Low |
|
- |
- |
- |
|
13 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera Adults |
- |
|
[NOEDD for bee larvae = 5.3 ug/day] |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
161 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Coccinella septempunctata |
- |
|
467 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Chrysoperla carnea |
- |
|
297 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Aphidius rhopalosiphi |
- |
|
55.0 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.011 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.059 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.010 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Americamysis bahia |
High |
|
0.18 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Chironomus riparius as EC₅₀ |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
2.8 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Lemna gibba |
Moderate |
|
- |
- |
- |
|
4.5 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Pseudokirchneriella subcapitata |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.1 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rabbit SF=100 Australia |
- |
|
None allocated |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Australia |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Metabolised and rapidly eliminated in faeces and urine |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
May distrupt developmentcausibng reduced weights & decreased feeding |
|
|
|
Not hghly flammable Not explosive or oxidising |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
Stable for around 2 years under normal storage conditions |
|
|
|
florylpicoxamid |
|
florylpicoxamide |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
14/12/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |