Picloram-tripromine |

Last updated: 25/08/2024
|
 |
(Also known as: picloram-tris(2-hydroxypropyl)ammonium; picloram triisopropanolamine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide which is a variant of picloram, used for the control of broad-leaved weeds on non-crop and utility areas |
|
Woody plants; Brush; Broad-leaved weeds including leafy spurge, knapweeds, thistles, toadflax, birdsfood trefoil and hoary cress. Will not control crucifers |
|
Non-cropped areas; Rangeland |
|
- |
|
Current |
|
circa 2013, introduced |
|
Approved |
|
31/12/2029 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Poland/Czech Republic |
|
15/02/2028 |
|
No |
|
Yes - as picloram |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
|
|
|
✓ |
✓ |
✓ |
✓ |
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
|
|
✓ |
|
✓ |
✓ |
✓ |
✓ |
|
|
|
|
- |
|
C₁₅H₂₄Cl₃N₃O₅ |
|
CC(CN(CC(C)O)CC(C)O)O.C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
|
- |
|
XQVYHLBQRMKACP-UHFFFAOYSA-N |
|
InChI=1S/C9H21NO3.C6H3Cl3N2O2/c1-7(11)4-10(5-8(2)12)6-9(3)13;7-1-3(10)2(8)5(9)11-4(1)6(12)13/h7-9,11-13H,4-6H2,1-3H3;(H2,10,11)(H,12,13) |
|
Yes |
|
Herbicide |
|
Pyridine herbicide; Picolinic acid herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic absorbed by roots and leaves and translocated. Synthetic auxin. |
|
6753-47-5 |
|
229-815-1 |
|
174 |
|
- |
|
62620 |
|
No data found |
|
432.73 |
|
4-amino-3,5,6-trichloropyridine-2-carboxylic acid—1,1′,1″-nitrilotri[(2E)-propan-2-ol] (1/1) |
|
(2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|
4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with 1,1′,1″-nitrilotris[2-propanol] (1:1) |
|
Marine pollutant |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
|
|
560 |
as picloram |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.20 X 10-02 |
Calculated |
- |
|
-1.92 |
as picloram |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
8.0 X 10-05 |
as picloram |
Low volatility |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
23.0 |
as picloram |
Non-persistent |
|
23.0 |
as picloram |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
4012 |
Rat as picloram |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 1944 |
Anas platyrhynchos as picloram |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
Apis mellifera as picloram |
Low |
|
> 74 |
Apis mellifera as picloram |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
8.8 |
Oncorhynchus mykiss as picloram |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
44.2 |
Daphnia magna as picloram |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
4012 |
Rat as picloram |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.3 |
as picloram |
- |
|
0.3 |
as picloram |
- |
|
- |
- |
- |
|
0.3 |
as picloram |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H319 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
picloram-tripromine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
25/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |