(E)-methyl 2-[2-[[[(Z)[1-(3,5-bis(trifluoromethyl)phenyl)-1-methylthiomethylidene]amino]oxy]methyl]phenyl]-3-methoxyacrylate (Ref: HNPC-A3066) |

Last updated: 12/06/2024
|
 |
(Also known as: HNPCA3066) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A novel strobilurin insecticide that exhibits larvicidal and ovicidal activities against various acarids |
|
Spider mites including the two spotted red spider mite (Tetranychus urticae), European red mite (Panonychus ulmi) and cutrus red mite (Panonychus citri) |
|
- |
|
- |
|
Novel |
|
circa 2005, discovered China |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
C₂₂H₁₉F₆NO₄S |
|
O=C(OC)/C(C1=CC=CC=C1CO/N=C(C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)\SC)=C/OC |
|
- |
|
CCKDEYQMJWFLNX-HOKJOAGDSA-N |
|
InChI=1S/C22H19F6NO4S/c1-31-12-18(20(30)32-2)17-7-5-4-6-13(17)11-33-29-19(34-3)14-8-15(21(23,24)25)10-16(9-14)22(26,27)28/h4-10,12H,11H2,1-3H3/b18-12+,29-19- |
|
Yes |
|
Insecticide, Acaricide |
|
Strobilurin insecticide |
|
>98% |
|
- |
|
Synthetic |
|
Quinone Outside Inhibitor (QoI) |
|
- |
|
- |
|
- |
|
- |
|
- |
|
507.45 |
|
- |
|
(E)-methyl 2-[2-[[[(Z)[1-(3,5-bis(trifluoromethyl)phenyl)-1-methylthiomethylidene]amino]oxy]methyl]phenyl]-3-methoxyacrylate |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
11 |
|
Not applicable |
|
- |
|
Powdery solid |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
2-sulfinic acid methyl |
- |
- |
- |
2-benzoic acid carbomethoxy sulfonyl carbamate |
- |
- |
- |
4-methoxy-6-(methylthio) pyrimidin-2-amine |
- |
- |
- |
4-methoxy-6-(methylsulfinyl) pyrimidin-2-amine |
- |
- |
- |
2-benzoic acid carbomethoxy sulfonyl carbamate |
- |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
No data found |
No data found |
|
|
|
No information available |
|
|
|
Shipped under ambient temperature as non-hazardous chemical |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
Store at 0 - 4 DegC for short term (days to weeks), or -20 DegC for long term (months). Shelf Life is >3 years if stored according to supplier instructions |
|
|
|
(E)-methyl 2-[2-[[[(Z)[1-(3,5-bis(trifluoromethyl)phenyl)-1-methylthiomethylidene]amino]oxy]methyl]phenyl]-3-methoxyacrylate |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |