Isoprothiolane (Ref: SS 11946) |

Last updated: 16/05/2024
|
 |
(Also known as: IPT; NNF 109) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An insecticide and fungicide used to control a range of rice pests |
|
Rice stem rot, Fusarium leaf spot, Planthoppers |
|
Rice, Bananas |
|
- |
|
Considered obsolete but may be available in some countries |
|
1975, first reported and introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₁₈O₄S₂ |
|
CC(C)OC(=O)C(=C1SCCS1)C(=O)OC(C)C |
|
No data |
|
UFHLMYOGRXOCSL-UHFFFAOYSA-N |
|
InChI=1S/C12H18O4S2/c1-7(2)15-10(13)9(11(14)16-8(3)4)12-17-5-6-18-12/h7-8H,5-6H2,1-4H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
isoprothiolane |
- |
 |
|
Fungicide, Insecticide |
|
Phosphorothiolate insecticide; Phosphorothiolate fungicide; Dithiolane fungicide |
|
- |
|
- |
|
Synthetic |
|
Systemic with protective and curative action. Phospholipid biosynthesis inhibitor (methyltransferase/group 2) |
|
50512-35-1 |
|
610-537-8 |
|
456 |
|
- |
|
39681 |
|
No data found |
|
290.40 |
|
- |
|
diisopropyl 1,3-dithiolan-2-ylidenemalonate |
|
bis(1-methylethyl) 1,3-dithiolan-2-ylidenepropanedioate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
6 |
|
- |
|
White crystals |
|
|
|
- King Tech Corp.
- Nihon Nohyaku Co. Ltd.
- Nichino America, Inc
|
|
- Fudiolan
- Fuji-One
- Fujiwang
- Vifusi
|
|
Available in a variety of formulations including emulsifiable concentrates, granules, wettable powders and low and ultralow volume sprays. |
|
|
|
|
|
|
|
48.5 |
|
Moderate |
|
1512000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
761000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
4061000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Acetone |
- |
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
|
54.6 |
|
- |
|
175 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.31 X 1002 |
Calculated |
- |
|
2.8 |
|
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.25 |
|
- |
|
Does not dissociate |
|
- |
- |
|
0.493 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
1.00 X 10-01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
78 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
FAO data: DT₅₀ aerobic range 61-95 days; DT₅₀ anaerobic, flooded 182-990 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
|
Stable |
|
Stable at pH4, less so at pH9 |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
1352 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.64 |
Calculated |
Low leachability |
|
|
4.96 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
354 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Threshold for concern |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
diisopropyl 1- oxo-1,3- dithiolan-2-ylidenemalonate |
isoprothiolane monosulfoxide |
Plant; Mouse |
- |
monoisopropyl, 1,3-dithiolan-2-ylidenemalonate |
isoprothiolane monoester |
Plant; Mouse; Rat |
- |
diisopropyl 4- hydroxy-1,3- dithiolan-2-ylidenemalonate |
4-hydroxy isoprothiolane |
Plant; Animal |
- |
didehydro isoprothiolane |
- |
Plant; Rat |
- |
hydroxyl-isopropyl isoprothiolane |
- |
Plant |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
< 300 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4180 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 240.7 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
11.4 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 10 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
10.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data Pseudokirchneriella subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
< 300 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Moderate |
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
> 2.77 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H302 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
isoprothiolane |
|
isoprothiolane |
|
Isoprothiolan |
|
isoprothiolan |
|
isoprothiolane |
|
isoprotiolan |
|
- |
|
izoprotiolan |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
16/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |