Methoxychlor (Ref: OMS 466) |

Last updated: 14/11/2024
|
 |
(Also known as: methoxychlore; dimethoxy-DT; dianisyl trichloroethane; ENT 1716; DMDT) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An insecticide effective against a wide range of pests encountered in agricultural (crops and livestock), horticulture and domestic situations |
|
Flies, Mosquitoes; Cockroaches; Chiggers |
|
Liverstock pest control; Domestic gardens; Pet pest management |
|
- |
|
Current |
|
circa 1948, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A prochiral molecule |
|
C₁₆H₁₅Cl₃O₂ |
|
COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)C(Cl)(Cl)Cl |
|
- |
|
IAKOZHOLGAGEJT-UHFFFAOYSA-N |
|
InChI=1S/C16H15Cl3O2/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12/h3-10,15H,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
methoxychlor |
- |
 |
|
Insecticide, Veterinary substance |
|
Organochloride insecticide |
|
- |
|
- |
|
Synthetic |
|
Contact and stomach action. Central nervous stimulant, producing hyperactivity, convulsions and death. Sodium channel modulator. |
|
72-43-5 |
|
200-779-9 |
|
14 |
|
034001 |
|
4115 |
|
No data found |
|
345.65 |
|
- |
|
1,1,1-trichloro-2,2-bis(4-methoxyphenyl)ethane |
|
1,1'-(2,2,2-trichloroethylidene)bis(4-methoxybenzene) |
|
POP candidate; OSPAR pfa |
|
- |
|
Not applicable |
|
Not applicable |
|
3B |
|
Not applicable |
|
Ctenocephalides felis, Cydia pomonella, Euxoa ochrogaster, Haematobia irritans, Helicoverpa zea, many more |
|
Colourless crystalline solid |
|
|
|
|
|
- Double-M
- Chemform
- Moxie
- Marlate
|
|
Supplied in a variety of formulations including emulsifiable concentrates, wettable powders, flowables, seed treatments and aerosols |
|
|
|
|
|
0.1 |
|
Low |
|
440000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
50000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
700000 |
Trichloroethane |
- |
1333000 |
Dichloromethane |
- |
|
87 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.76 X 1005 |
Calculated |
- |
|
5.83 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.41 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
0.08 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low volatility |
|
2.00 X 10-02 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
120 |
|
Persistent |
|
120 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
6.5 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Cherry leaves, n=1 |
|
|
1.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
Collard leaves, n=1 |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
80000 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.88 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
1622 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (Other literature values Log BCF range 2.8-4.1 (R3)) |
Threshold for concern |
|
Not available |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 6000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
- |
|
200 |
- |
|
- |
- |
- |
|
> 2000 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 23.6 |
Apis mellifera |
Moderate |
|
5.0 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.052 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
> 0.59 |
Danio rerio Embryo |
Moderate |
|
0.00078 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
0.001 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
0.014 |
Ceriodaphnia dubia |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
36.7 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus dilutus 10 day LC₅₀ |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.6 |
Scenedesmus quadricauda |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 0.325 |
Crassostrea gigas Larva |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 6000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.1 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Non-statutory WHO drinking water guideline 0.02 mg l⁻¹ |
UK EA QS database 2018 |
- |
|
- |
- |
- |
|
Metabolised and mainly eliminated through the faeces |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Endocrine issues - strong estrogenic effect Potential kidney & liver toxicant IARC Group 3 carcinogen - not classifiable; CLP data - suspected carcingen May damage vital organs |
|
|
|
Highly flammable and easily ignited by heat, sparks and flames IMDG Transport Hazard Class 6.1 |
|
Health: H302, H312, H332, H351, H371 Environment: H400 |
|
U (Unlikely to present an acute hazard) |
|
UN2761 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
methoxychlor |
|
methoxychlore |
|
Methoxychlor |
|
methoxychlor |
|
metossicloro |
|
metoxiclor |
|
- |
|
metoksychlor |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
14/11/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |