Promecarb (Ref: SN 34615) |

Last updated: 24/07/2024
|
 |
(Also known as: SSI 0792) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete phenyl methylcarbamate insecticide once used to combat foliage and fruit eating insects |
|
Fruit flies; Houseflies; Moths; Leaf miners; Corn rootworm; Colorado beetles |
|
Turf; Veterinary applications; Fruit including grapes; Onions; Ornamentals |
|
- |
|
Considered obsolete but may be available in some countries |
|
1965, first reported |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₂H₁₇NO₂ |
|
CC1=CC(=CC(=C1)OC(=O)NC)C(C)C |
|
No data |
|
DTAPQAJKAFRNJB-UHFFFAOYSA-N |
|
InChI=1S/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
|
Yes |
|
Insecticide, Veterinary substance |
|
Carbamate insecticide; Phenyl methylcarbamate insecticide |
|
>97% |
|
- |
|
Synthetic |
|
Systemic. Rapid knock down with contact and stomach action. Acetylcholinesterase (AchE) inhibitor. |
|
2631-37-0 |
|
220-113-0 |
|
None allocated |
|
271400 |
|
17516 |
|
No data found |
|
207.3 |
|
- |
|
5-methyl-m-cumenyl methylcarbamate |
|
3-methyl-5-(1-methylethyl)phenyl methylcarbamate |
|
Marine Pollutant |
|
- |
|
Not applicable |
|
Not applicable |
|
1A |
|
Not applicable |
|
Tribolium castaneum |
|
Colourless crystalline solid |
|
|
|
|
|
- Carbamult
- Minacide
- Morton EP
|
|
Often supplied as emulsifiable concentrates or wettable powder |
|
|
|
|
|
91 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
- |
- |
- |
|
87 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.26 X 1003 |
Calculated |
- |
|
3.1 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
4 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
9.10 X 10-03 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
20 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Non-persistent |
|
- |
- |
- |
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
103 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
300 |
|
Other sources: 2000 mL g⁻¹ (DW3) |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
2.20 |
Calculated |
Transition state |
|
|
9.30 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
75 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
78 |
Phasianidae |
High |
|
- |
- |
- |
|
- |
- |
- |
|
> 8.81 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.31 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
Low (class III) |
- |
- |
|
> 23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
High |
|
450 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
0.16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Mainly eliminated in urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Toxic is swallowed Possible liver and kidney toxicant |
|
|
|
Incompatible with alkaline substances IMDG Transport Hazard Class 6,1 |
|
Health: H301 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2757 |
|
- |
|
- |
|
|
|
promecarb |
|
promecarbe |
|
Promecarb |
|
promecarb |
|
promecarb |
|
promecarb |
|
promecarb |
|
promekarb |
|
- |
|
- |
|
promecarb |
|
- |
Record last updated: |
24/07/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |