Propachlor (Ref: CP 31393) |

Last updated: 22/08/2024
|
 |
(Also known as: propachlore) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A pre-emergence herbicide for control of annual grasses and some broad-leaved weeds |
|
Annual ryegrass; Barnyard grass; Pimpernel; Chickweed; Deadnettle; Fleabane; Shepherd's purse; Fathen |
|
Soybeans; Grain sorghum; Corn; Peas; Pumkins; Cotton; Flax |
|
- |
|
Current |
|
1964, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Netherlands |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₁H₁₄ClNO |
|
CC(C)N(C1=CC=CC=C1)C(=O)CCl |
|
No data |
|
MFOUDYKPLGXPGO-UHFFFAOYSA-N |
|
InChI=1S/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
propachlor |
- |
 |
|
Herbicide |
|
Chloroacetanilide herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, systemic, effects cell formation and protein synthesis. Inhibition of VLCFA (inhibition of cell division). |
|
1918-16-7 |
|
217-638-2 |
|
176 |
|
019101 |
|
4931 |
|
616-008-00-8 |
|
211.69 |
|
- |
|
2-chloro-N-isopropylacetanilide |
|
2-chloro-N-(1-methylethyl)-N-phenylacetamide |
|
Marine Pollutant; Chemical subject to PIC regulations |
|
- |
|
K3 |
|
15 |
|
Not applicable |
|
Not applicable |
|
- |
|
Light tan solid |
|
|
|
- AgriGuard
- Certis
- Greencrop
- Makhteshim-Agan
- Nufarm
|
|
- Alpha Propachlor 50SC
- Ashlade CP
- Titan 480
- Ramrod
|
|
Often supplied as emulsifiable concentrates, granules or suspension concentrate |
|
|
|
|
|
|
|
580 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
353900 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
205500 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
296100 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Toluene |
- |
655900 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Benzene |
- |
|
77 |
|
- |
|
- |
- |
- |
|
170 |
|
- |
|
174 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (open cup) |
- |
|
|
3.98 X 1001 |
Calculated |
- |
|
1.6 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.13 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
30.6 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
3.65 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
5 |
|
Non-persistent |
|
3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data 1-10 days; Other sources: DT₅₀ 6 days (DW4) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
18 |
|
Slow |
|
- |
|
|
28 |
|
Non-persistent |
|
- |
|
84 |
|
Moderately fast |
|
4.5 |
|
Moderately fast |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
80 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.00 |
Calculated |
Low leachability |
|
|
2.27 X 10-03 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
37 |
Whole fish |
Low potential |
|
Not available |
- |
|
|
|
|
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
Aerobic |
|
- |
- |
- |
|
- |
- |
Aerobic |
Known groundwater metabolites |
|
None
|
|
|
|
propachlor methyl sulfoxide |
- |
Water (Anaerobic) |
- |
2-hydroxy-N-(1-methylethyl)-N-phenyl acetamide |
propachlor alcohol |
Water (Anaerobic) |
- |
N-(1-methylethyl)-N-phenylacetamide |
norchloropropachlor |
Water (Anaerobic) |
- |
propachlor disulfide |
- |
Water (Anaerobic) |
- |
2[(1-methylethyl)phenylamino]-2-oxo-ethane sylfonic acid |
propachlor sulfonic acid |
Water (Anaerobic) |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
> 1500 |
Rat |
Moderate |
|
|
5.4 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
High |
|
- |
- |
|
- |
- |
- |
|
> 91 |
Colinus virginianus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
218 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
197 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 7.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
0.612 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
1.8 |
Chironomus riparius 48 hr EC₅₀ |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
0.005 |
Lemna gibba |
High |
|
- |
- |
- |
|
0.015 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
0.01 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 1500 |
Rat |
Moderate |
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
1.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
US EPA - probable human carcinogen |
|
|
|
IMDG Transport Hazard Class 9 |
|
Health: H302, H317, H319 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
propachlor |
|
propachlore |
|
Propachlor |
|
propachlor |
|
propaclor |
|
propacloro |
|
propachlor |
|
propachlor |
|
- |
|
propaklor |
|
propachloor |
|
- |
Record last updated: |
22/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |