Ferimzone (Ref: TF-164) |
Last updated: 23/05/2024
|
|
(Also known as: meferimzone; (Z)-ferimzone) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A systemic pyrimidine fungicide used to control various fungal infections in rice and a few other crops |
|
Brown spot (Helminthosporium oryzae); Narrow brown leaf spot; Cercospora leaf spot (Cercospora oryzae); Rice blast (Pyricularia oryzae). Smut (Tilletia horrida |
|
Rice; Cowpea |
|
- |
|
Current |
|
1991, first registered China |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric, existing in the E- and Z-forms. The name Ferimzone only refers to the Z-isomer of the compound, as this is more stable. The mixture of both isomers is called meferimzone (CAS number: 77359-18-3). |
|
C₁₅H₁₈N₄ |
|
CC1=CC=CC=C1C(=NNC2=NC(=CC(=N2)C)C)C |
|
CC1=CC=CC=C1/C(=N\NC2=NC(=CC(=N2)C)C)/C |
|
GOWLARCWZRESHU-AQTBWJFISA-N |
|
InChI=1S/C15H18N4/c1-10-7-5-6-8-14(10)13(4)18-19-15-16-11(2)9-12(3)17-15/h5-9H,1-4H3,(H,16,17,19)/b18-13- |
|
Yes |
|
Fungicide, Other substance |
|
Wood preservative |
|
Pyrimidine fungicide |
|
- |
|
- |
|
Synthetic |
|
Disrupts membrane function. Thought to inhibit mycelial growth and spore germination. |
|
89269-64-7 |
|
254.33 |
|
618-259-9 |
|
None allocated |
|
- |
|
9013425 |
|
No data found |
|
254.33 |
|
4,6-dimethyl-2-{2-[(1Z)-1-(2-methylphenyl)ethylidene]hydrazinyl}pyrimidine |
|
(Z)-2′-methylacetophenone (4,6-dimethylpyrimidin-2-yl)hydrazone |
|
4,6-dimethyl-2(1H)-pyrimidinone (2Z)-[1-(2-methylphenyl)ethylidene]hydrazone |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not known |
|
- |
|
White crystaline solid |
|
|
|
- Takeda Chemical Industries Ltd
|
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
175.5 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
9.55 X 1002 |
Calculated |
- |
|
2.98 |
|
Moderate |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
725 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
725 |
Rat |
Moderate |
|
2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
> 3.8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
No data found |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
May damage vital organs |
|
|
|
Protect from light and moisture |
|
Health: H302, H319, H371 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
ferimzone |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
23/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |