Binapacryl (Ref: FMC 9044) |

Last updated: 23/08/2024
|
 |
(Also known as: endosan; HOE 02784; OMS 571) |
Binapacryl is a fungicide. It has a low aqueous solubility, is highly volatile and would not normally be expected to leach to groundwater. Binapacryl may be persistent in soil systems. It is highly toxic to mammals, may cause adverse development/fertility effects and is a known skin irritant. Binapacryl is highly toxic to fish and aquatic invertebrates and moderately toxic to birds and honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete contact fungicide and acaricide once used to control mildew and mites on certain fruits and vegetables. An ester of dinoseb. |
|
Powdery mildew; Panonychid and Tetranychid mites |
|
Apples; Pears; Cucumber |
|
- |
|
Considered obsolete - banned or voluntarily withdrawn - but may be available in some countries |
|
circa 1960, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
No applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A racemate comprising equimolar amounts of (R)- and (S)-binapacry |
|
C₁₅H₁₈N₂O₆ |
|
CCC(C)C1=CC(=CC(=C1OC(=O)C=C(C)C)[N+](=O)[O-])[N+](=O)[O-] |
|
- |
|
ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
|
InChI=1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
|
Yes |
|
Fungicide, Insecticide, Miticide, Acaricide |
|
Dinitrophenol acaricide; Dinitrophenol insecticide; Dinitrophenol fungicide |
|
- |
|
- |
|
Synthetic |
|
Non-systemic. As a miticide it works with ovicidal action, uncoupling or inhibiting oxidative phosphorylation. Respiration inhibitor. |
|
485-31-4 |
|
207-612-9 |
|
138 |
|
012201 |
|
10234 |
|
609-024-00-1 |
|
322.31 |
|
rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenyl 3-methylbut-2-enoate |
|
(RS)-2-sec-butyl-4,6-dinitrophenyl 3-methylcrotonate |
|
2-(1-methylpropyl)-4,6-dinitrophenyl 3-methyl-2-butenoate |
|
Severe Marine Pollutant; Rotterdam Convention (Class O) - subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
13 |
|
29 |
|
Panonychus citri, Panonychus ulmi, Tetranychus urticae, Tetranychus mcdanieli |
|
Colourless to yellow or brownish crystalline powder |
|
|
|
|
|
- Acricid
- Ambox
- Morocide
- Endosan
- Dinapacryl
- Niagara 9044
|
|
Formulated as emulsifiable concentrates and wettable poweders |
|
|
|
|
|
1 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
780000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Acetone |
- |
110000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Ethanol |
- |
700000 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Xylene |
- |
400 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
67 |
|
- |
|
Decomposes before boiling |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.62 X 1004 |
Calculated |
- |
|
4.75 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.24 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
13 |
at 60°C |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
0.034 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
100 |
|
Persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
General literature states that it may undergo slow hydrolysis |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
2400 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.24 |
Calculated |
Low leachability |
|
|
2.86 X 10-02 |
Calculated |
- |
|
- |
|
High |
Calculated |
- |
|
Slightly mobile |
Calculated |
- |
|
- |
- |
- |
|
|
2400 |
Calculated |
Threshold for concern |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
dinoseb (Ref: HOE 26150) |
- |
Mammal (dog) |
- |
3-(2-hydroxy-3,5-dinitrophenyl)-butanol |
- |
Mammal (dog) |
- |
3-(2-hydroxy-3,5-dinitrophenyl)-butyric acid |
- |
Mammal (dog) |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
58 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 800 |
Gallus domesticus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 50 |
|
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Moderately harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.05 |
Oncorhynchus mykiss |
High |
|
- |
- |
- |
|
- |
- |
- |
|
0.03 |
Asellus brevicaudus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
10.8 |
Scenedesmus subspicatus |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
58 |
Rat |
High |
|
720 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
The probable routes of exposure to binapacryl are by dermal contact or inhalation of dust |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Highly toxic and may damage liver, kidneys and nervous system Shows teratogenicity |
|
|
|
Avoid generation of dust It is readily hydrolized by strong acids or dilute alkalis |
|
Health: H302, H312, H360D Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
binapacryl |
|
binapacryl |
|
Binapacryl |
|
binapacryl |
|
binapacril |
|
binapacril |
|
binapacryl |
|
binapakryl |
|
- |
|
- |
|
binapacryl |
|
- |
Record last updated: |
23/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |