Monepantel |
Last updated: 18/05/2024 |
(Not known by any other names) |
|
|
A broad spectrum anthelmintic veterinary drug | |
---|---|---|
|
Current | |
|
2009, Switzerland | |
|
Used to control and treat gastro-intestinal roundworms | |
|
Sheep; Goats |
Approval status |
|
Approved | |
---|---|---|
|
Approved |
Chemical structure |
|
Isomeric | |
---|---|---|
|
C₂₀H₁₃F₆N₃O₂S | |
|
CC(COC1=C(C=CC(=C1)C#N)C(F)(F)F)(C#N)NC(=O)C2=CC=C(C=C2)SC(F)(F)F | |
|
C[C@@](COC1=C(C=CC(=C1)C#N)C(F)(F)F)(C#N)NC(=O)C2=CC=C(C=C2)SC(F)(F)F | |
|
WTERNLDOAPYGJD-GOSISDBHSA-N | |
|
InChI=1S/C20H13F6N3O2S/c1-18(10-28,11-31-16-8-12(9-27)2-7-15(16)19(21,22)23)29-17(30)13-3-5-14(6-4-13)32-20(24,25)26/h2-8H,11H2,1H3,(H,29,30)/t18-/m1/s1 | |
|
Yes |
|
Common Name | Relationship | Link |
---|---|---|
monepantel | - |
General status |
|
Nematicide, Antiparasitic, Anthelmintic, Medicinal drug | |
---|---|---|
|
Amino-acetonitrile derivative | |
|
- | |
|
- | |
|
Synthetic | |
|
Paralyses worms by attacking a previously undiscovered receptor - Hco-MPTL-1 - only present in nematodes | |
|
[Nicotinic acetylcholine receptor, Blocker] | |
|
887148-69-8 | |
|
- | |
|
- | |
|
- | |
|
- | |
|
Antiparasitic products, insecticides & repellents: anthelmintics | |
|
QP52AX09 | |
|
No | |
|
Allowed substance (Table 1: Ovine, Caprine) | |
|
473.39 | |
|
- | |
|
N-(2-cyano-1[(2S)-5-cyano-2-(trifluoromethyl)phenoxy)propan-2-yl)-4-(trifluoromethylsulfanyl)benzamide | |
|
N-[(1S)-1-cyano-2-(5-cyano-2-fluoromethylphenoxy)-1-methylethyl]-4-trifluoromethylsulfanylbenzamid | |
|
- | |
|
- | |
|
White powdery solid |
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
Zolvix 25 mg/ml Oral Solution for Sheep | Elanco GmbH | GB National authorisation | Prescription only medicine to be authorised by a registered, qualified person (POM-VPS) | ||||||
|
Usually formulated as oral solutions |
|
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.08 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low | ||||||||
|
6900 | E4 E = Manufacturers safety data sheets Propylene glycol4 = Verified data |
- | ||||||||
7300 | E4 E = Manufacturers safety data sheets n-Octanol4 = Verified data |
- | |||||||||
60700 | E4 E = Manufacturers safety data sheets Ethanol4 = Verified data |
- | |||||||||
175000 | E4 E = Manufacturers safety data sheets Dichloromethane4 = Verified data |
- | |||||||||
|
145 | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
2.82 X 1004 | Calculated | - | |||||||
|
4.45 | E4 E = Manufacturers safety data sheets 4 = Verified data |
High | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.468 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
2.8 X 10-06 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
92 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
DT₅₀ ranges 38-146 days, rate depends on sand fraction in soil: less sand = faster degradation | ||||||||||
|
- | - | - | ||||||||
|
|
Stable | E4 E = Manufacturers safety data sheets 4 = Verified data |
Stable | |||||||
|
Stable under normal environmental conditions | ||||||||||
|
|
Stable | E4 E = Manufacturers safety data sheets 4 = Verified data |
Stable | |||||||
|
Stable under normal environmental conditions | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. | ||||||||||
|
- |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | E4 E = Manufacturers safety data sheets 4 = Verified data |
Non-mobile | |||||||
|
7481 | ||||||||||
|
Koc range 6082-8880 mL g⁻¹, Soils=5 | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.25 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
- | - | - | |||||||||||||||||||||||||
|
- | - |
Known soil and groundwater metabolites |
None
Other known metabolites |
|
|
|
|
||||
---|---|---|---|---|---|---|---|
monepantel sulfone | - | - | - |
|
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
> 2000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
2.4 | E4 E = Manufacturers safety data sheets Eisenia foetida 56 day4 = Verified data |
Moderate | ||||||||
|
[No impact up to 0.3 mg kg⁻¹ soil] | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | E2 E = Manufacturers safety data sheets Non-toxic2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | E2 E = Manufacturers safety data sheets Non-toxic2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | E2 E = Manufacturers safety data sheets Non-toxic2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
> 2000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
2000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
May be absorbed through the skin | ||||||||||
|
Excretion was mainly via the faeces as metabolites following intravenous administration, but over 50% remains in unchanged form following oral administration | E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible liver and kidney toxicant |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
Not listed (Not listed) | |||
|
- | |||
|
- | |||
|
- |
|
|
|
||
---|---|---|---|
|
monepantel | ||
|
monepantel | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 18/05/2024 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |