Promecarb (Ref: SN 34615) |
![]() Last updated: 08/02/2024 |
![]() |
(Also known as: SSI 0792) |
|
![]() |
|
An obsolete phenyl methylcarbamate insecticide | |
---|---|---|
|
Considered obsolete but may be available in some countries | |
|
1965, first reported | |
|
Used topically for the control of flying and biting insects | |
|
Cattle; Horses |
Approval status |
|
Not approved | |
---|---|---|
|
Not approved |
Chemical structure |
|
None | |
---|---|---|
|
C₁₂H₁₇NO₂ | |
|
CC1=CC(=CC(=C1)OC(=O)NC)C(C)C | |
|
No data | |
|
DTAPQAJKAFRNJB-UHFFFAOYSA-N | |
|
InChI=1S/C12H17NO2/c1-8(2)10-5-9(3)6-11(7-10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Carbamate insecticide; Phenyl methylcarbamate insecticide | |
|
>97% | |
|
- | |
|
Synthetic | |
|
Systemic. Cholinesterase inhibitor. Rapid knock down with contact and stomach action. | |
|
[Cholinesterase, Inhibitor] | |
|
2631-37-0 | |
|
220-113-0 | |
|
None allocated | |
|
271400 | |
|
17516 | |
|
No data found | |
|
- | |
|
None allocated | |
|
No | |
|
- | |
|
207.3 | |
|
- | |
|
5-methyl-m-cumenyl methylcarbamate | |
|
3-methyl-5-(1-methylethyl)phenyl methylcarbamate | |
|
Marine Pollutant | |
|
- | |
|
Colourless crystalline solid |
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | - | ||||||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
91 | H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
87 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.26 X 1003 | Calculated | - | |||||||
|
3.1 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
4 | H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable | ||||||||
|
9.10 X 10-03 | H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
20 | M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
28 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
103 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile | |||||||
|
300 | ||||||||||
|
Other sources: 2000 mL g⁻¹ (DW3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
2.20 | Calculated | Transition state | ||||||||||||||||||||||||||
|
|
75 | Q2 Q = Miscellaneous data from online sources Estimated2 = Unverified data of unknown source |
Low potential | |||||||||||||||||||||||||
|
Not available | - |
Known metabolites |
None
|
![]() |
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
> 23 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
High | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
78 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) Phasianidae3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 8.81 | R4 R = Peer reviewed scientific publications Eisenia foetida4 = Verified data |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.1 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.31 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
Low (class III) | - | - | ||||||||
|
> 23 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
High | ||||||||
|
450 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.16 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
Mainly eliminated in urine | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Toxic is swallowed Possible liver and kidney toxicant |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Incompatible with alkaline substances IMDG Transport Hazard Class 6,1 |
|||
|
Health: H301 Environment: H400, H410 |
|||
|
Not classified: Obsolete (Not classified: Obsolete) | |||
|
UN2757 | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
promecarb | ||
|
promecarbe | ||
|
Promecarb | ||
|
promecarb | ||
|
promecarb | ||
|
promecarb | ||
|
promecarb | ||
|
promekarb | ||
|
- | ||
|
- | ||
|
promecarb | ||
|
- |
Record last updated: | 08/02/2024 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |