TCA-sodium |
Last updated: 05/02/2024 |
(Also known as: STCA; NaTA; NaTCA) |
|
|
A pre-emergence herbicide used to control many annual and perennial weeds | |
---|---|---|
|
Considered obsolete but may be available in some countries | |
|
circa 1950, introduced | |
|
- | |
|
- |
Approval status |
|
- | |
---|---|---|
|
- |
Chemical structure |
|
None | |
---|---|---|
|
C₂Cl₃NaO₂ | |
|
C(=O)(C(Cl)(Cl)Cl)[O-].[Na+] | |
|
- | |
|
SAQSTQBVENFSKT-UHFFFAOYSA-M | |
|
InChI=1S/C2HCl3O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1 | |
|
Yes |
General status |
|
- | |
---|---|---|
|
Halogenated aliphatic herbicide | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic, absorbed by roots and translocated. Inhibition of lipid synthesis | |
|
- | |
|
650-51-1 | |
|
211-479-2 | |
|
67 | |
|
081001 | |
|
23681045 | |
|
No data found | |
|
- | |
|
- | |
|
- | |
|
- | |
|
185.37 | |
|
sodium trichloroacetate | |
|
sodium trichloroacetate | |
|
sodium trichloroacetate | |
|
- | |
|
- | |
|
Pale yellow powder | |
|
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | - | ||||||
|
- |
|
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
120000 | H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High | ||||||||
|
232000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | ||||||||
7600 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
200 | L3 L = Pesticide manuals and hard copy reference books / other sources Diethyl ether3 = Unverified data of known source |
- | |||||||||
70 | L3 L = Pesticide manuals and hard copy reference books / other sources Benzene3 = Unverified data of known source |
- | |||||||||
|
165 | L2 L = Pesticide manuals and hard copy reference books / other sources Decomposes2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
2.14 X 1001 | Calculated | - | |||||||
|
1.33 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.62 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
0.70 | DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- | ||||||||
Strong acid | |||||||||||
|
0.01332 | H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility | ||||||||
|
1.37 X 10-03 | V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Non-volatile | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
55 | M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Literature DT₅₀ range 21-90 days | ||||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. | ||||||||||
|
- |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Very mobile | |||||||
|
3 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
6.13 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
0.002 | Q2 Q = Miscellaneous data from online sources Estimated2 = Unverified data of unknown source |
Low potential | |||||||||||||||||||||||||
|
Not available | - |
Known metabolites |
None
|
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
3200 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 4280 | L3 L = Pesticide manuals and hard copy reference books / other sources Gallus domesticus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
> 100 | L1 L = Pesticide manuals and hard copy reference books / other sources 1 = Estimated data with little or no verification |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
> 11000 | L1 L = Pesticide manuals and hard copy reference books / other sources Percidae spp.1 = Estimated data with little or no verification |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 3100 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents / FAO data, IPCS INCHEM data (US EPA Databases Related to Pesticide Risk Assessment ) Daphnia magna4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1.0 | P3 P = Other non-EU, UK or US Governments and Regulators Pseudokirchneriella subcapitata Growth3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - |
|
- | - | - |
|
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
3200 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
365.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Corrosive to skin Harmful if swallowed |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Corrosive Prevent generation of dust Reacts with strong bases producing chloroform |
|||
|
Health: H314 Environment: H400, H410 |
|||
|
III (Slightly hazardous) | |||
|
- | |||
|
- | |||
|
- |
|
|
|
||
---|---|---|---|
|
TCA-sodium | ||
|
trichloracetate de sodium | ||
|
TCA | ||
|
TCA (trichloreddikesyre) | ||
|
TCA | ||
|
TCA-sodio | ||
|
TCA | ||
|
TCA | ||
|
TCA | ||
|
TCA | ||
|
TCA-natrium | ||
|
- |
Record last updated: | 05/02/2024 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |