Calcium carbonate |
Last updated: 31/10/2024
|
|
(Also known as: marble dust; calcite; limestone) |
A multi-use substance predominately used as an animal repellent but which also has some pesticide activity. It has a low aqueous solubility but would not be expected to persist in the environment. Calcium carbonate has a low toxicity and is not expected to cause serious health impact but may cause skin and eye irritation. It generally has a low ecotoxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An inorganic substance mainly used as animal repellent but which also has herbicide, fungicide and/or microbiocide activity. |
|
Game - mammals & birds |
|
Forestry; Fruit orchards; Deciduous and coniferous trees; Shrubs; Ornamentals |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Withdrawn |
|
No data |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Spain/Hungary |
|
31/10/2036 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
CaCO₃ |
|
C(=O)([O-])[O-].[Ca+2] |
|
No data |
|
VTYYLEPIZMXCLO-UHFFFAOYSA-L |
|
InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
calcium carbonate |
- |
|
|
Herbicide, Fungicide, Semiochemical, Other substance |
|
pH adjuster; Carrier, Microbiocide |
|
Inorganic compound |
|
995 g kg⁻¹ |
|
- |
|
Natural |
|
Unappealing texture. Elevates gastric pH. Protective, inhibiting fungal spores and pathogens from entering the host tissues. |
|
Calcium carbonate occurs naturally in the earths crust |
|
Manufactered industrially for commercial applications from chalk, limestone, or marble by either a wet or dry grinding process |
|
Landscape management |
|
Damaging mammals and birds - particularly game |
|
Forestry; Fruit orchards; Deciduous and coniferous trees; Shrubs; Ornamentals |
|
- |
|
471-34-1 |
|
207-439-9 |
|
843 |
|
073502 |
|
10112 |
|
No data found |
|
100.09 |
|
calcium carbonate |
|
calcium carbonate |
|
calcium carbonate |
|
calcium carbonate |
|
Note: Substance is not approved as 'chalk' |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
NC |
|
- |
|
White powder |
|
|
|
|
- |
- |
|
Usually supplied as a solution or wettable granules. When used as a repellent it can be applied with a brush to individual plants, shrubs and trees. |
|
|
|
|
|
14.0 |
|
Low |
|
Insoluble |
Ethanol |
- |
|
825 |
|
- |
|
Decomposes before boiling |
|
- |
|
825 |
|
- |
|
- |
- |
- |
|
|
Not applicable |
- |
- |
|
Not applicable |
|
Not applicable |
|
|
- |
- |
- |
|
- |
- |
- |
|
2.83 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Not applicable |
|
- |
|
|
|
|
|
- |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Natural substance that rapidly disperses in the environment |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source expert judgement |
Low |
|
> 837 |
Eisenia foetida |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
343 |
Apis mellifera |
Low |
|
337 |
Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
> 200 |
Oncorhynchus mykiss |
Low |
|
- |
- |
- |
|
> 100 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 42.0 |
Unknown species as product |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Rat |
Low |
|
2000 |
Rat |
- |
|
> 3.0 |
Rat 4 hr |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Exposure not considered significant - low risk |
|
Exposure not considered significant - low risk |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
May cause hypotension May cause dose related constipation and/or mild gastrointestinal discomfort May cause kidney damage at very high doses |
|
|
|
Corrosive Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
Health: H315, H318, H319, H335, H336, H372 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
calcium carbonate |
|
caronate de calcium |
|
Calciumcarbonat |
|
calciumkarbonat |
|
carbonato di calcio |
|
carbonato del calcio |
|
- |
|
weglan wapnia |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
31/10/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |