| Indolylacetic acid |

Last updated: 28/11/2025
|
 |
(Also known as: IAA; AIA; beta-indoleacetic acid; auxins; heteroauxin; indole-3-ylacetic acid) |
| A botanical extract that can be used as a plant growth regulator for use indoors but which does not have EU approval for use. It is highly soluble in water and volatile. Little is known about its environmental persistance but there are indications that it may be persistent under certain conditions in water. However, it is unstable in UV light. It is moderately toxic to mammals but generally not thought to present significant risk of causing problems for human health although there are uncertainties regarding its effect for reproduction and the CNS. Little is known regarding its ecotoxicology. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A botanical auxin extract used to improve rootings of woody plant cuttings |
|
|
Growth |
|
|
Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₀H₉NO₂ |
|
|
C1=CC=C2C(=C1)C(=CN2)CC(=O)O |
|
|
No data |
|
|
SEOVTRFCIGRIMH-UHFFFAOYSA-N |
|
|
InChI=1S/C10H9NO2/c12-10(13)6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6H2,(H,12,13) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| indolylacetic acid |
- |
 |
|
|
Plant Growth Regulator |
|
|
Plant-derived substance; Micro-organism derived substance |
|
|
990 g kg⁻¹ |
|
|
EU dossier - none declared |
|
|
Natural |
|
|
Broad-spectrum, effects cell division and elongation stimulating the formation of roots. |
|
|
A plant auxin that is produced in cells of the buds and young leaves of plants, In addition, various microorganisms have shown the ability to produce IAA, such as bacteria, actinomycetes, fungi or yeast |
|
|
Yield enhancement |
|
|
None - PGR |
|
|
Ornamentals |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
87-51-4 |
|
|
201-748-2 |
|
|
8186 |
|
|
128915 |
|
|
- |
|
|
175.18 |
|
|
- |
|
|
1H-indole-3-acetic acid |
|
|
indol-3-ylacetic acid |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale pink crystals |
|
|
|
|
|
|
|
|
Current |
|
|
Circa 1940s, developed; 1946, first introduced |
|
|
- ACF Chemiefarma
- Hortus USA
- Acros Organics BVBA
|
|
|
- Rhizopon A powder
- Rhizopon AA
- 1H-Indole-3-acetic acid, 99+%
|
|
|
Often supplied as a dustable powder or as water soluble tablets |
|
|
Indole-3-acetic acid is produced commercially using microbial fermentation processes. Specific strains of bacteria or fungi, such as Streptomyces fradiae or Rhizobium sp. are selected for their high production capabilities. The microorganisms are cultured under optimised conditions and incubated in a suitable medium, often supplemented with L-tryptophan, which is a precursor for Indole-3-acetic acid production. After fermentation, Indole-3-acetic acid is extracted from the culture medium and purified using techniques like thin-layer chromatography and high-performance liquid chromatography |
|
|
Data for the amount of life cycle GHGs produced by indolylacetic acid are not available in the public domain. However, whilst estimates vary, similar small molecules emit roughly 0.5-1.0 kg CO₂e per kg of product under conventional energy mixes. |
|
|
|
|
|
|
|
|
|
|
1500 |
|
High |
|
|
1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
| 65000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Diethyl ether |
- |
| 65000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 20000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
|
|
167 |
|
- |
|
|
363 |
|
- |
|
|
- |
- |
- |
|
|
171 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
|
2.57 X 1001 |
Calculated |
- |
|
|
1.41 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.576 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
4.75 |
|
- |
| Weak acid |
|
|
0.021 |
|
Low volatility |
|
|
2.3 X 10-06 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Neutral: max at 220nm, shoulders at 200nm, 280nm |
|
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature reports rapid degradation in soil |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
|
- |
|
|
Unstable in UV light |
|
|
|
Stable |
|
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1.69 |
Scenedesmus quadricauda |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
0.169 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 1.77 |
Rat |
- |
|
|
Intraperitoneal LD₅₀ = 150 mg kg⁻¹ |
Mouse |
- |
|
|
Not allocated |
|
- |
|
|
Not allocated |
|
- |
|
|
- |
- |
- |
|
|
0.055 |
Mouse SF=900 |
- |
|
|
11.3 |
|
- |
|
|
- |
- |
- |
|
|
|
Not expected to pose a significant risk |
|
|
Not expected to pose a significant risk |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause respiratory problems |
|
|
|
|
|
Light sensitive Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Health: H315, H319, H335 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
Limited shelf life. Store at -20 DegC |
|
|
|
|
|
indolylacetic acid |
|
|
AIA |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
28/11/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.