| Bilanafos (Ref: MW 801) |

Last updated: 20/10/2025
|
 |
(Also known as: AIDS 132579; bialaphos; SF 1293; bilanaphos; bialafos) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
A naturally occurring peptide herbicide used to control various annual and perennial crops |
|
|
Annual and perennial weeds |
|
|
Grapes: Apples; Citrus |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Bilanafos exhibits optical isomerism due to the presence of multiple chiral centres in its tripeptide structure. Specifically, the molecule contains three stereogenic carbon atoms, each located within the amino acid residues that make up the compound: two L-alanine units and phosphinothricin, a glutamic acid analog. These chiral centres allow bilanafos to exist in multiple stereoisomeric forms, including enantiomers and diastereomers. In commercial and research applications, bilanafos is typically supplied as a single stereoisomer, not a racemic mixture. |
|
|
C₁₁H₂₂N₃O₆P |
|
|
CC(C(=O)NC(C)C(=O)O)NC(=O)C(CCP(=O)(C)O)N |
|
|
C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)[C@H](CCP(=O)(C)O)N |
|
|
GINJFDRNADDBIN-FXQIFTODSA-N |
|
|
InChI=1S/C11H22N3O6P/c1-6(9(15)14-7(2)11(17)18)13-10(16)8(12)4-5-21(3,19)20/h6-8H,4-5,12H2,1-3H3,(H,13,16)(H,14,15)(H,17,18)(H,19,20)/t6-,7-,8-/m0/s1 |
|
|
Yes |
|
|
Herbicide |
|
|
Micro-organism derived substance; Peptide herbicide |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Pro-toxin. Non-selective, systemic, contact action. Glutamine synthetase inhibitor: accumulates ammonium ions, inhibits photosynthesis. |
|
|
Isolated from the soil bacterium Streptomyces hygroscopicus (Jensen) Waksman & Henrici and Streptomyces viridochromeogenes (Krainsky) Waksman & Henrici, It is a protoxin, degrading to glufosinate in the plant. |
|
|
Crop protection |
|
|
A wide range of post-emergence annual and perennial broad-leaved weeds |
|
|
Grapes: Apples; Citrus |
|
|
- |
|
|
35597-43-4 |
|
|
- |
|
|
None allocated |
|
|
- |
|
|
5462314 |
|
|
323.28 |
|
|
- |
|
|
(2S)-2-amino-4-[hydroxy(methyl)phosphinoyl]butyryl-L-alanyl-L-alanine |
|
|
(2S)-2-amino-4-(hydroxymethylphosphinyl)butanoyl-L-alanyl-L-alanine |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R04 Rule 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
- |
|
|
H |
|
|
10 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Solid |
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
1984, introduced |
|
|
- Meiji Seika Kaisha
- Japan
- Bayer CropScience
|
|
|
- Herbie
- Herbi-Ace
- Basta
- Ignite
- Liberty
|
|
|
Usually supplied as a soluble powder or as liquid formulations |
|
|
It is produced commercially through a fermentation process involving specific Streptomyces strains of soil bacteria. The selected bacterial strains are cultured in a controlled environment to produce bilanafos. It is then extracted from the fermentation broth and purified. The purified bilanafos is then formulated chemically usually as bilanafos-sodium. |
|
|
Data for the amount of life cycle GHGs produced by bilanafos are not available in the public domain. However, whilst estimates vary, more general data suggests that between 18 and 27 kilograms of CO₂e is emitted per kilogram of herbicide produced. |
|
|
|
|
|
|
|
|
|
|
1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
250000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
| 500000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Methanol |
- |
|
|
160 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.71 X 10-03 |
Calculated |
- |
|
|
-2.06 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.33 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
Stable |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
Not pH sensitive |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| 4-[(hydroxy)(methyl)phosphinyl]butyric acid |
- |
Mice (Faeces) |
- |
| glufosinate (Ref: HOE 00661) |
- |
Plant |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
268 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Gallus domesticus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Non-toxic |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
26.8 |
Worst case of acute and chronic mammals |
|
|
500 |
Worst case of acute and chronic birds |
|
|
200 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
10 |
Worst case of temperate acute and chronic fish |
|
|
50 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
268 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 3000 |
Rat |
- |
|
|
2.57 |
Rat |
- |
|
|
Intravenous LD₅₀ = 80 mg kg⁻¹ |
Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No adverse health effects noted |
|
|
|
|
|
No information available |
|
|
Health: H301, H302, H312, H315, H319, H332, H335, H361, H370 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
bilanafos |
|
|
- |
|
|
- |
|
|
bilanafos |
|
|
bilanafos |
|
|
bilanafos |
|
|
- |
|
|
bilanafos |
|
|
bilanafos |
|
|
- |
|
|
bilanafos |
|
|
- |
| Record last updated: |
20/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.