| Gossyplure (Ref: PP761) |

Last updated: 29/08/2025
|
 |
(Also known as: BRN 1911945; Pink bollworm sex pheromone; Z7Z11-16Ac; Z7E11-16Ac) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
| Environmental fate |
Ecotoxicity |
Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A pheromone used to control Pink bollworms |
|
|
Pink bollworm (Pectinophora gossypiella) |
|
|
Cotton |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Gossyplure exhibits geometrical (cis-trans) isomerism, specifically involving double bond configurations in its diene structure. Chemically, it is a mixture of two isomers which differ in the spatial arrangement around their double bonds (1) (Z,Z)-gossyplure with both double bonds at positions 7 and 11 are in the cis (Z) configuration; (2) (Z,E)-gossyplure with the double bond at position 7 is cis (Z), while the one at position 11 is trans (E). |
|
|
C₁₈H₃₂O₂ |
|
|
CCCCC=CCCC=CCCCCCCOC(=O)C.CCCCC=CCCC=CCCCCCCOC(=O)C |
|
|
CCCC/C=C/CC/C=C\CCCCCCOC(=O)C.CCCC/C=C\CC/C=C\CCCCCCOC(=O)C |
|
|
FAWDISLMBWXNGG-BVNMUOCFSA-N |
|
|
InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7,10-11H,3-5,8-9,12-17H2,1-2H3 |
|
|
Yes |
|
|
Insecticide; Semiochemical |
|
|
Pheromone |
|
|
>90% |
|
|
- |
|
|
Natural |
|
|
Insect attractant used to distrupt mating |
|
|
Sex pheromone of the pink bollworm (Pectinophora gossypiella) isolated from females |
|
|
Crop protection |
|
|
Pink bollworm (Pectinophora gossypiella) |
|
|
Cotton |
|
|
- |
|
|
50933-33-0 |
|
|
256-857-8 / 257-737-8 |
|
|
None allocated |
|
|
114101 |
|
|
- |
|
|
280.45 |
|
|
- |
|
|
1:1 mixture of (7Z,11E)- and (7Z,11Z)-hexadeca-7,11-dien-1-yl acetate |
|
|
(7Z)-7,11-hexadecadienyl acetate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNM |
|
|
Not applicable |
|
|
- |
|
|
Colourless to straw coloured liquid |
|
|
|
|
|
Current |
|
|
1985, introduced |
|
|
|
|
|
|
|
|
Usually supplied as slow release formulations but spray formulations are also available |
|
|
Gossyplure is produced commercially through a series of chemical, multi-stage synthesis. The synthesis begins with the butylation of 1,5-hexadiyne. The resulting 1,5-decadiyne undergoes partial reduction using sodium in liquid ammonia to yield deca-(E)-5-enyne. This substance is then alkylated with hexamethylene halohydrin or a similar compound. The final steps involve further chemical reactions to produce the desired stereoisomers of gossyplure which are subsequently formulated into usable products. |
|
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
|
|
|
0.2 |
|
Low |
|
|
- |
- |
- |
|
|
25 |
|
- |
|
|
173 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
167 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.00 X 1004 |
Calculated |
- |
|
|
4.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.885 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
11.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.0 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Stable |
|
|
Stable at all relevant pH's |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
1000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
> 5620 ppm |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 120.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.70 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
> 2.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Acute percutaneous LD₅₀ > 2000 mg kg⁻¹ |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
No adverse health effects identified |
|
|
|
|
|
No information available |
|
|
Health: H315, H319 Environment: H413 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
gossyplure |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
29/08/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |