| Naphthalene |

Last updated: 24/10/2025
|
 |
(Also known as: tar camphor; naphthaline; moth balls) |
| Naphthalene is only used for non-food applications. Slightly toxic if ingested but more serious effects may be seen if inhaled. It is considered a skin and eye irritant. It is also thought to be carcinogenic. Little is known about its environmental fate mainly because its usage patterns would minimise its release. Data suggests that it would be rapidly lost from the soil by evaporation, volatilization, and biodegradation. Non-toxic to birds and earthworms. It is moderately toxic to aquatic species but exposure is unlikely. No data for the risk posed to honeybees has been identified. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A largely obsolete insecticide once used as a moth repellant for the protection of textiles and as an animal repellant against nuisance vertebrate pests. It is also a constituent of some inert product additives. |
|
|
Moths |
|
|
Non-cropped situations; Wool clothing and textiles |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₀H₈ |
|
|
C1=CC=C2C=CC=CC2=C1 |
|
|
- |
|
|
UFWIBTONFRDIAS-UHFFFAOYSA-N |
|
|
InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| naphthalene |
- |
 |
|
|
Repellent; Other substance |
|
|
Constituent of some solvents |
|
|
Fumigant pesticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Repellent action caused by strong odour, DNA damage response |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
91-20-3 |
|
|
202-049-5 |
|
|
613-139-00-2 |
|
|
055801 |
|
|
931 |
|
|
613-139-00-2 |
|
|
128.17 |
|
|
naphthalene |
|
|
naphthalene |
|
|
naphthalene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
EU Directive 2008/105/EC EQS Inland surface waters: 2.4 µg l⁻¹; other surface waters 1.2 µg l⁻¹ as annual average |
|
|
- |
|
|
|
- |
|
|
Yes [ R02 Rule 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ; R11 Rule 11: Pesticide active ingredients that are environmentally persistent (where sediment phase only DT₅₀ => 90 days or water phase only DT₅₀ => 90 days or DT₅₀ (field) => 60 days (note lab values are used when field values are not available)) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline flaky solid |
|
|
|
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
1948, first registered as a pestcide USA; 2008, banned EU |
|
|
|
|
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
|
Was usually supplied as pellets, granules or flakes and applied by hand |
|
|
Naphthalene is primarily produced from coal tar distillation, a process that extracts it as one of the major components from the volatile by-products of coke production. During this process, bituminous coal is heated in the absence of air, generating coke and releasing coke oven gas, which contains naphthalene along with other aromatic hydrocarbons. The gas is then cooled and condensed, allowing naphthalene to crystallise and be separated. It can also be synthesized from petroleum feedstocks via dealkylation of methylnaphthalenes in the presence of hydrogen at high temperature and pressure, although this method is less common today. For laboratory synthesis, the Haworth method involves a series of reactions starting with Friedel–Crafts acylation of benzene with succinic anhydride, followed by Clemmensen reduction, cyclisation, and dehydrogenation to yield the fused aromatic ring system of naphthalene. |
|
|
The GHG emissions from the production of naphthalene depend on a large number of variables. If the coal tar distillation/recovery route is used which uses steam and electricity for distillation and only minor solvent use cradle to gate GHG estimate is likely to be in the range 0.3-1.0 kg CO₂e per kg product. However, if the petroleum route (dealkylation/reforming) is used with high temperature reactors then emissions are likely to be higher and in the range 1.5-3.0 kg CO₂e per kg product. These ranges reflect typical industrial energy intensities for separation and aromatics processing, plus upstream energy for fuels and hydrogen. |
|
|
|
|
|
|
|
|
|
|
31.0 |
at 25 °C |
Moderate |
|
|
285000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 77000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
|
|
81.2 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
218 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
88 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
|
1.95 X 1003 |
Calculated |
- |
|
|
3.29 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.14 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
6500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
2.78 X 1001 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
80 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature data reports DT₅₀'s of around 80 days unless the soil is contaminated with polycyclic aromatic hydrocarbons which will facilitate much quicker degradation rates. |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
250 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
750 |
|
|
Literature states Koc values range 200-1470 ml/g |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| cis-1,2-dihydroxy-1,2-dihydronaphthalene |
- |
- |
- |
| 1,2-dihydroxy-naphthalene |
- |
- |
- |
| 2-hydroxchromene-2-carboxylate |
HCCA |
- |
- |
| trans-o-hydroxy-benzylidenpyruvate |
tHBPA |
- |
- |
| salicyladehyde |
- |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5620 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2730 |
Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 0.11 |
Oncorhynchus mykiss |
Moderate |
|
|
> 0.67 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus kisutch 40 day |
Moderate |
|
|
- |
- |
- |
|
|
> 15.0 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 25.0 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
220 |
Worst case of acute and chronic mammals |
|
|
562 |
Worst case of acute and chronic birds |
|
|
546 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.0011 |
Worst case of temperate acute and chronic fish |
|
|
0.15 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
2.5 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
> 2500 |
Rat |
- |
|
|
> 0.34 |
Rat 1 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Exposure may occur via inhalation, skin absorption, ingestion, skin and/or eye contact |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Blood toxicant at high doses Liver toxicant May cause hemolytic anemia IARC Group 2B carcinogen; CLP data - suspected carcinogen; US NTP - suspected carcinogen; OSHA - Anticipated human carcinogen |
|
|
|
|
|
Flammable |
|
|
Health: H302, H351 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
naphthalene |
|
|
naphtalene |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
naftalen |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
24/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |