Blasticidin-S (Ref: BcS-3) |

Last updated: 22/05/2025
|
 |
(Also known as: BeS-3) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A foliar applied rice blast fungicide |
|
Rice blast (Pyricularia oryzae) |
|
Rice |
|
- |
|
- |
|
Current |
|
1959, first described |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Blasticidin-S is a chiral molecule |
|
C₁₇H₂₆N₈O₅ |
|
CN(CCC(CC(=O)NC1C=CC(OC1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N |
|
CN(CC[C@@H](CC(=O)N[C@@H]1C=C[C@H](O[C@H]1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N |
|
CXNPLSGKWMLZPZ-GIFSMMMISA-N |
|
InChI=1S/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29) |
|
Yes |
|
Fungicide; Antibiotic |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Contact with protective and curative action, acts by inhibiting protein biosynthesis |
|
Isolated from the inhibiting soil actinomycete Streptomyces griseochromogenes |
|
The bacterium Streptomyces griseochromogenes is cultured in a suitable medium under controlled conditions to produce blasticidin-S. Blasticidin-S is extracted from the fermentation broth using various chemical processes, purified and formulated into a usable product, such as a powder or solution. |
|
Crop protection |
|
Rice blast ()Pyricularia oryzae) |
|
Rice |
|
- |
|
2079-00-7 |
|
11002-92-9; 12767-55-4; 51775-28-1 |
|
- |
|
None allocated |
|
- |
|
170012 |
|
422.4 |
|
- |
|
1-(4-amino-1,2-dihydro-2-oxopyrimidin-1-yl)-4-[(S)-3-amino-5-(1-methylguanidino)valeramido]-1,2,3,4-tetradeoxy-ß-D-erythro-hex-2-enopyranuronic acid |
|
(S)-4-[[3-amino-5-[(aminoiminomethyl)methylamino]-1-oxopentyl]amino]-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,2,3,4-tetradeoxy-β-D-erythro-hex-2-enopyranuronic acid |
|
- |
|
PAN Listed as Highly Hazardous Chemical |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
23 |
|
- |
|
Colourless crystalline solid |
|
|
|
|
Bla-S |
Nihon Nohyaku |
|
Usually supplied as a water dispersible powders, emulsifiable concentrates and wettable powders |
|
|
|
|
|
30 |
|
Moderate |
|
30000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetic acid |
- |
|
Decomposes on melting |
|
- |
|
- |
- |
- |
|
235 |
|
- |
|
- |
- |
- |
|
|
2.09 X 10-05 |
Calculated |
- |
|
-4.68 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
2.4 |
|
- |
Strong acid, pKa(2)=4.6, pKa(3)=8.0, pKa(4)>12.5 |
|
- |
- |
- |
|
1.52 X 10-29 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature gives DT₅₀ >2 days - mean of two soils |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
|
Stable |
|
- |
|
|
Stable |
|
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
1500 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
deaminohydroxy blasticidin-S |
- |
Rice |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
16.0 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia pulex |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
16.0 |
Rat |
High |
|
500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
Intravenous LD₅₀ = 2.82 mg kg⁻¹ |
Mouse |
- |
Intraperitoneal LD₅₀ = 10 mg kg⁻¹ |
Mouse |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Occupational exposure may occur through inhalation and dermal contact |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Highly hazardous |
|
|
|
Prevent generation of dust IMDG Transport Hazard Class 6.1 |
|
- |
|
Ib (Highly hazardous) |
|
UN2588 |
|
- |
|
- |
|
|
|
blasticidin-S |
|
- |
|
Blastizidin |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/05/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |