| Methyl anthranilate |

Last updated: 18/10/2025
|
 |
(Also known as: nevoli oil; methyl aminobenzoate; anthranilic acid methyl ester; MA; neroli oil) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A naturally occurring substance extracted from plants including grapes, neroli, oranges and ylang ylang that can be used as a bird repellent |
|
|
Birds |
|
|
Fruit ripening on trees and bushes; Maize; Rice; Fruit; Sports greens |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₈H₉NO₂ |
|
|
COC(=O)C1=CC=CC=C1N |
|
|
No data |
|
|
VAMXMNNIEUEQDV-UHFFFAOYSA-N |
|
|
InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| methyl anthranilate |
- |
 |
|
|
Repellent |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Physical repellent action based on odour and taste |
|
|
Extracted from a wide range of plants including grapes, neroli, wisteria, oranges and ylang ylang. It is also secreted by the musk glands of foxes and dogs |
|
|
Crop protection; Leisure sites - golf courses |
|
|
Birds |
|
|
Fruit ripening on trees and bushes; Maize; Rice; Fruit; Sports greens |
|
|
- |
|
|
134-20-3 |
|
|
205-132-4 |
|
|
- |
|
|
128725 |
|
|
8635 |
|
|
151.17 |
|
|
- |
|
|
methyl 2-aminobenzoate |
|
|
methyl anthranilate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
Has GRAS approval under US 21 CFR 182.60 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Clear to pale yellow liquid with fruity smell |
|
|
|
|
|
Current |
|
|
- |
|
|
- Bird Shield Repellent Corp
- Roth Chemical Company
- Lansdowne Aromatics
- BSRC
|
|
|
|
|
|
Agricultural products are usually delivered in liquid emulsions or solutions |
|
|
Methyl anthranilate is commercially produced primarily through petroleum-based chemical processes. The most common method involves the esterification of anthranilic acid with methanol in the presence of an acid catalyst. The process requires large quantities of acid catalysts and the disposal of toxic liquid acids after the reaction. An alternative approach involves microbial production which involves metabolic engineering of microorganisms like Escherichia coli and Corynebacterium glutamicum to produce methyl anthranilate directly from glucose. This process optimizes enzyme expression, increases precursor supply, and enhances cofactor availability, making it a more sustainable and natural method. |
|
|
The estimated GHG emissions from the commercial production of methyl anthranilate varies according to the production method. Petroleum-based synthesis is estimated to emit approximately 3-7 kg CO₂e per kg of product. Emissions from microbial fermentation processes typically range 0.5–2.0 kg CO₂e per kg of product. |
|
|
|
|
|
|
|
|
|
|
2850 |
|
High |
|
|
- |
- |
- |
|
|
24 |
|
- |
|
|
256 |
|
- |
|
|
- |
- |
- |
|
|
110 |
|
- |
|
|
|
7.59 X 1001 |
Calculated |
- |
|
|
1.88 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.17 |
|
- |
|
|
2.23 |
|
- |
| Strong acid |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2910 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2036 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
25 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
23.19 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
291 |
Worst case of acute and chronic mammals |
|
|
203.6 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
0.5 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.2319 |
Worst case of temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2910 |
Rat |
Low |
|
|
> 5000 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Mainly excreted via the urine |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause asthmatic response, some ancedotal evidence of respiratory tract damage May cause discomfort if swallowed |
|
|
|
|
|
Combustable Not explosive or corrosive |
|
|
Health: H315, H319, H335 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
methyl anthranilate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
18/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |