Copper II acetate |
Last updated: 10/05/2024
|
|
(Also known as: copper acetate; copper(2+) acetate; cupric diacetate) |
This is an inorganic copper based fungicide. It is highly soluble in water and is non-volatile. It is highly toxic to fish and has a moderate mammalian toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An inorganic-copper fungicide |
|
Powdery mildew; Downy mildew; Leaf spot; Blight; Stem canker |
|
Vegetables; Fruit |
|
- |
|
- |
|
Current |
|
1889, first fungicide product |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
Cu₂(CH₃COO)₄ |
|
CC(=O)[O-].CC(=O)[O-].[Cu+2] |
|
- |
|
OPQARKPSCNTWTJ-UHFFFAOYSA-L |
|
InChI=1S/2C2H4O2.Cu/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
|
Yes |
|
Fungicide |
|
Inorganic compound |
|
- |
|
- |
|
Natural |
|
Protective, inhibiting fungal spores and pathogens from entering the host tissues. Multi-site activity. |
|
Copper acetate occurs in natural in various mineral rocks including hoganite. |
|
It is produced industrially by a chemical reaction with copper hydroxide and acetic acid |
|
Crop protection |
|
Powdery mildew; Downy mildew; Leaf spot; Blight; Stem canker |
|
Vegetables; Fruit |
|
- |
|
142-71-2 |
|
205-553-3 |
|
44 |
|
- |
|
8895 |
|
No data found |
|
181.63 |
|
- |
|
copper(II) acetate |
|
cupric acetate |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
M01 |
|
- |
|
Dark green crystalline solid |
|
|
|
|
|
72000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
High |
|
- |
- |
- |
|
115 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.17 X 10-02 |
Calculated |
- |
|
-1.38 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.88 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
1.00 X 10-10 |
Q1 Q = Miscellaneous data from online sources 1 = Estimated data with little or no verification |
Low volatility |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Copper ion rapidly released in soil. Copper is a naturally occurring element and, as such, does not then degrade further. DT₅₀ of Cu >10,000 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Very mobile |
|
1 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
710 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
6.7 |
Eisenia foetida |
High |
|
15 |
Eisenia foetida as Cu 56 day |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 50 |
|
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.069 |
Cyprinidae spp. |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
59.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data Chironomus riparius as mg Cu/kg |
Moderate |
|
- |
- |
- |
|
0.55 |
H1 H = The US ARS pesticide properties database. Dataset is no longer available. 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
710 |
Rat |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
10 |
|
- |
|
List II |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
No data found |
No data found |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
Potential heavy metal poisoning Harmful if inhaled or ingested |
|
|
|
Prevent generation of dust |
|
Health: H302, H314, H318 Environment: H400, H411 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
copper II acetate |
|
acétate de cuivre |
|
Kupferacetat |
|
Kobberacetat |
|
acetato di rame |
|
acetato de cobre |
|
- |
|
octan miedzi (II) |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
10/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |