1,7-dioxaspiro(5.5)undecane |

Last updated: 25/08/2025
|
 |
(Also known as: Olive fly sex pheromone; olean; olive-fly ketal) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
A volatile substance that is an insect sex pheromone and used as an attractant |
|
Olive flies (Bactrocera oleae) |
|
Olives |
|
- |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
C₉H₁₆O₂ |
|
C1CCOC2(C1)CCCCO2 |
|
No data |
|
GBBVHDGKDQAEOT-UHFFFAOYSA-N |
|
InChI=1S/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
|
Yes |
|
Insecticide; Semiochemical |
|
Pheromone |
|
>95% |
|
- |
|
Natural |
|
Functions as an insect attractant - mating disrupter & lure |
|
A chemical released by virgin female olive flies (Bactrocera oleae) |
|
Crop protection |
|
Olive flies (Bactrocera oleae) |
|
Olives |
|
Suitable for use in all farming systems where approved for use in that country |
|
180-84-7 |
|
205-870-7 |
|
- |
|
124851 |
|
- |
|
156.23 |
|
- |
|
1,7-dioxaspiro(5.5)undecane |
|
1,7-dioxaspiro(5.5)undecane |
|
- |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not known |
|
Not applicable |
|
- |
|
Volatile colourless liquid |
|
|
|
|
|
Current |
|
- |
|
|
|
|
|
Usually formulated as a spray or for use in traps |
|
The synthesis of 1,7-dioxaspiro(5.5)undecane begins with a suitable starting material, often a long-chain alkene or alkyne which undergoes a cyclisation reaction to form the spirocyclic structure characteristic of 1,7-dioxaspiro[5.5]undecane. Functional groups are added to the spirocyclic structure to achieve the desired chemical properties. This may involve the introduction of oxygen atoms to form the dioxaspiro structure. The final product, 1,7-dioxaspiro[5.5]undecane, is purified using techniques such as distillation or chromatography. |
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2500 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Expert judgement |
Low |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source No adverse effects identified or expected |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
No adverse human health effects noted |
|
|
|
Not explosive or oxisiding |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
1,7-dioxaspiro(5.5)undecane |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
25/08/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |