| (Z)-dodec-9-enyl acetate (Ref: BAS 281 I) |

Last updated: 23/10/2025
|
 |
(Also known as: Grapeberry moth sex pheromone; Sonolure; Z9-12Ac; Straight Chain Lepidopteran Pheromone; grapemone; SCLP) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
| Environmental fate |
Ecotoxicity |
Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
A volatile substance used as an attractant and lure for the Grapeberry moth (Eupoecilia ambiguella) |
|
|
Grapeberry moths (Eupoecilia ambiguella) |
|
|
Grape vines |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Italy/France |
|
|
30/08/2037 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
✓ |
  |
  |
  |
✓ |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
✓ |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
(Z)-dodec-9-enyl acetate exhibits geometric (E/Z) isomerism, which arises from the presence of a carbon–carbon double bond at the 9th position in its 12-carbon chain. |
|
|
C₁₄H₂₆O₂ |
|
|
CCC=CCCCCCCCCOC(=O)C |
|
|
CC/C=C\CCCCCCCCOC(=O)C |
|
|
MFFQOUCMBNXSBK-PLNGDYQASA-N |
|
|
InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-5H,3,6-13H2,1-2H3/b5-4- |
|
|
No |
|
|
Insecticide; Semiochemical |
|
|
Pheromone |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Functions as an insect attractant - mating disrupter |
|
|
Isolated from virgin female grapeberry moths (Eupoecilia ambiguella) |
|
|
Crop protection |
|
|
Grapeberry moths (Eupoecilia ambiguella) |
|
|
Grape vines |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
16974-11-1 |
|
|
241-054-7 |
|
|
422 |
|
|
117701 / 129004 |
|
|
- |
|
|
226.36 |
|
|
- |
|
|
Z-9-dodecen-1-yl acetate |
|
|
(Z)-dodec-9-enyl acetate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R12 Rule 12: Pesticide active ingredients that are bioaccumulative (where bio-concentration factor (BCF) > 2000 l kg⁻¹ (if BCF is not available, where Log P >=5)) ] |
|
|
Marine pollutant |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid |
|
|
|
|
|
|
|
|
Current |
|
|
- |
|
|
|
|
|
|
|
|
Usually supplied in slow release formulations and dispensers but is also available in formulations for spray application |
|
|
The commercial production of pheromone attractants and lures involves a sophisticated blend of synthetic chemistry, entomology, and precision engineering. Manufacturers begin by identifying the specific pheromone compounds emitted by target pests, such as sex, aggregation, or alarm pheromones, and then replicate these molecules using chemical synthesis. |
|
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
|
|
|
0.57 |
|
Low |
|
|
Miscible |
Hexane |
- |
| Miscible |
Toluene |
- |
| Miscible |
Ethyl acetate |
- |
|
|
- |
- |
- |
|
|
242 |
|
- |
|
|
- |
- |
- |
|
|
126 |
|
- |
|
|
|
4.07 X 1005 |
Calculated |
- |
|
|
5.61 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
153 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
39.9 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Danio rerio |
Moderate |
|
|
2.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
> 2000 |
Rat |
- |
|
|
> 5.0 |
Rat 4 hr (whole body) |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
No adverse human health issues identified |
|
|
|
|
|
IMDG Transport Hazard Class 9 Not explosive or oxidising |
|
|
Health: H315 Environment: H410 |
|
|
Not listed (Not listed) |
|
|
UN3082 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
(Z)-dodec-9-enyl acetate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
23/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |