| (E,Z)-tetradeca-9,12-dienyl acetate |

Last updated: 23/10/2025
|
 |
(Also known as: Beet armyworm sex pheromone; E9Z12-14Ac) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
| Environmental fate |
Ecotoxicity |
Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
A volatile substance used as an attractant and lure for the beet armyworm and other insects |
|
|
Beet armyworm (Spodoptera exigua) |
|
|
Lucerne; Beets; Asparagus; Vegetables; Salad crops; Strawberries; Tobacco |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Italy/France |
|
|
30/08/2037 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
✓ |
  |
  |
  |
✓ |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
✓ |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
(E,Z)-Tetradeca-9,12-dienyl acetate exhibits geometric (E/Z) isomerism due to the presence of two double bonds at positions 9 and 12 in its 14-carbon chain. Each double bond can adopt either the E or Z configuration. |
|
|
C₁₆H₂₈O₂ |
|
|
CC=CCC=CCCCCCCCCOC(=O)C |
|
|
C/C=C\C/C=C/CCCCCCCCOC(=O)C |
|
|
ZZGJZGSVLNSDPG-WWVFNRLHSA-N |
|
|
InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3-,7-6+ |
|
|
Yes |
|
|
Insecticide; Semiochemical |
|
|
Pheromone |
|
|
>95% |
|
|
- |
|
|
Natural |
|
|
Functions as an insect attractant - mating disrupter |
|
|
Originally isolated from the abdominal segments of the female beet armyworm (Spodoptera exigua) |
|
|
Crop protection |
|
|
Beet armyworm (Spodoptera exigua) |
|
|
Lucerne; Beets; Asparagus; Vegetables; Salad crops; Strawberries; Tobacco |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
31654-77-0 |
|
|
250-753-6 |
|
|
867 |
|
|
- |
|
|
- |
|
|
252.40 |
|
|
- |
|
|
(E,Z)-tetradeca-9,12-dienyl acetate |
|
|
(E,Z)-9,12-tetradecadien-1-yl acetate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R12 Rule 12: Pesticide active ingredients that are bioaccumulative (where bio-concentration factor (BCF) > 2000 l kg⁻¹ (if BCF is not available, where Log P >=5)) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid |
|
|
|
|
|
|
|
|
Current |
|
|
- |
|
|
|
|
|
- Checkmat E BAW-F
- DKSH Pheromone dispenser
- Confuser Z
|
|
|
Usually supplied in slow release formulations and dispensers |
|
|
The commercial production of pheromone attractants and lures involves a sophisticated blend of synthetic chemistry, entomology, and precision engineering. Manufacturers begin by identifying the specific pheromone compounds emitted by target pests, such as sex, aggregation, or alarm pheromones, and then replicate these molecules using chemical synthesis. |
|
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
|
|
|
0.71 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
140 |
at 0.5mmHg |
- |
|
|
- |
- |
- |
|
|
110 |
|
- |
|
|
|
4.07 X 1005 |
Calculated |
- |
|
|
5.61 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
0.003 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
6.35 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.38 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.3 |
Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
> 2000 |
Rat |
- |
|
|
> 5.0 |
Rat 4 hr (whole body) |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No adverse human health issues identified |
|
|
|
|
|
Not explosive or oxidising |
|
|
Health: H315, H319, H335 |
|
|
Not listed (Not listed) |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
(E,Z)-tetradeca-9,12-dienyl acetate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
23/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |