Kasugamycin |
![](images/calendar_bpdb.png)
Last updated: 12/06/2024
|
![](images/BPDB_logo_64.png) |
(Also known as: kasugamycinic acid; crop antibiotic) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
An aminoglycoside antibiotic used, normally as the hydrochloride salt, against bacteria and some fungi. |
|
Bacterial rot (Erwinia atroseptica); Leaf mold (Cladosporium fulvum); Bacteria spot (Xanthomonas campestris, pv vesicatoria), Rice blast; Scab |
|
Tomatoes; Peppers; Rice; Potatoes; Sugar beet; Celery, Apples; Ornamentals |
|
- |
|
- |
|
Current |
|
1965, introduced |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Netherlands |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
India, Belize, Japan, Mexico, USA |
|
Kasugamycin is a chiral molecule |
|
C₁₄H₂₅N₃O₉ |
|
CC1C(CC(C(O1)OC2C(C(C(C(C2O)O)O)O)O)N)N=C(C(=O)O)N |
|
C[C@@H]1[C@H](C[C@@H]([C@H](O1)OC2[C@@H]([C@H](C([C@@H]([C@@H]2O)O)O)O)O)N)N=C(C(=O)O)N |
|
PVTHJAPFENJVNC-MHRBZPPQSA-N |
|
InChI=1S/C14H25N3O9/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24)/t3-,4+,5+,6-,7+,8+,9-,10+,11+,14-/m1/s1 |
|
Yes |
|
Fungicide, Crop antibiotic, Other substance, Metabolite |
|
Soil, Plant |
|
Wood preservative, Bactericide |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Contact action resulting in the inhibition of protein biosynthesis reducing bacterial growth and reproduction (bacteriostatic), rather than killing the bacteria directly. |
|
Isolated from soil bacterium Streptomyces kasugaensis |
|
Produced by controlled fermentation of S. Kasugaensis |
|
Crop protection |
|
Bacterial rot (Erwinia atroseptica); Leaf mold (Cladosporium fulvum); Bacteria spot (Xanthomonas campestris, pv vesicatoria), Rice blast; Scab |
|
Tomatoes; Peppers; Rice; Potatoes; Sugar beet; Celery, Apples; Ornamentals |
|
- |
|
6980-18-3 |
|
- |
|
- |
|
230001 |
|
- |
|
391.38 |
|
- |
|
(5-amino-2-methyl-6-(2,3,4,5,6-pentahydroxycyclohexyloxy)tetrahydropyran-3-yl)amino-a-iminoacetic acid |
|
3-O-(2-amino-4-((carboxyiminomethyl)amino)-2,3,4,6-tetradeoxy-a-D-arabino-hexopyranosyl)-D-chiro-inositol |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
24 |
|
- |
|
White, crystalline substance |
|
|
|
|
|
|
Kasumin 2L |
Arysta Lifesciences, USA |
Kasumin |
Hokko Chemical Industry |
|
Usually supplied as the hydrochloride formulated as a wettable powder |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
3.23 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
pKa(2) = 7.73, pKa(3) = 11.0 |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Literature states that substance rapidly breaks down to form ammonia, water and carbon dioxide |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
Secondary metabolite |
|
- |
- |
Secondary metabolite |
Known groundwater metabolites |
|
None
|
|
|
|
|
kasuganobiosamine |
- |
Plant |
- |
- |
ammonia Note: Secondary metabolite |
- |
Plant |
- |
- |
oxalic acid Note: Secondary metabolite |
- |
Plant |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
21000 |
Mouse |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 4000 |
Colinus virginianus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
21000 |
Mouse |
Low |
|
4000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
- |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
kasugamycin |
|
- |
|
- |
|
- |
|
- |
|
kasugamicina |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
12/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |