| Sodium hydrogen carbonate |

Last updated: 25/02/2026
|
 |
(Also known as: sodium bicarbonate; baking soda; bicarbonate of soda) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A fungicide for the control of fungal pathogens on a range of horticultural and other crops |
|
|
Powdery mildew; Post harvest disease control; Blackspot |
|
|
Fruit including grapes, apples, pears, plums, strawberries; Cucumbers; Stores; Ornamentals including roses; Turf |
|
|
In field trials powdery mildew on grapes controlled quite well compared to untreated control. |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Austria |
|
|
01/10/2035 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
CH₂O₃Na |
|
|
C(=O)(O)[O-].[Na+] |
|
|
No data |
|
|
UIIMBOGNXHQVGW-UHFFFAOYSA-M |
|
|
InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| sodium hydrogen carbonate |
- |
 |
|
|
Fungicide |
|
|
Inorganic compound |
|
|
990 g kg⁻¹ |
|
|
EU 2017 dossier: arsenic < 3mg kg⁻¹; lead < 2 mg kg⁻¹; mercury < 1 mg kg⁻¹ |
|
|
Natural |
|
|
Broad-spectrum, contact activity, rapid effect. Preventative with a slight curative activity |
|
|
Naturally occuring mineral found in natron (native soda) and is also found dissolved in mineral springs |
|
|
Crop protection |
|
|
- |
|
|
144-55-8 |
|
|
19621-89-9; 199723-76-7; 1182403-48-0; 151127-72-9; 172672-17-2 |
|
|
205-633-8 |
|
|
None allocated |
|
|
073505 |
|
|
516892 |
|
|
No data found |
|
|
84.01 |
|
|
carbonic acid, monosodium salt |
|
|
Sodium hydrogen carbonate |
|
|
Sodium bicarbonate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
E500(ii); EU Basic substance under Article 28 of Regulation (EC) No 1107/2009); UK Basic commodity substance implemented under the UK's Plant Protection Products Regulations 2011 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
NC |
|
|
- |
|
|
White crystalline powder |
|
|
|
|
|
Current |
|
|
Circa 1935, first report that bicarbonate salts showed fungicidal activity |
|
|
- Monterey Chemical Co.
- Agronaturalis
- Biofa AG
- Germany
|
|
|
- Kaligreen
- Armicarb
- NatriSan
|
|
|
Supplied as a soluble powder for use as a foliar spray |
|
|
The commercial production of sodium hydrogen carbonate typically involves reacting sodium carbonate with carbon dioxide in an aqueous solution under controlled cooling conditions. This process causes sodium hydrogen carbonate to precipitate out of the solution due to its lower solubility. The precipitate is then filtered, washed, and dried, often using plate dryers, to prevent decomposition back into sodium carbonate. While the Solvay process produces sodium hydrogen carbonate as an intermediate, it’s not suitable for high-purity applications, so dedicated production lines are used for these types of products. In some regions, especially the U.S., sodium bicarbonate is also derived from natural sources like trona ore, making the process more sustainable and cost-effective. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
103000 |
|
High |
|
|
Insoluble |
methanol |
- |
| Insoluble |
Acetone |
- |
| Insoluble |
Ethyl acetate |
- |
|
|
Decomposes before melting |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
50 |
|
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Rapidly biodegrades |
|
|
|
0.001 |
|
Non-persistent |
|
|
0.001 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Sodium hydrogen carbonate spontaneously dissociates to sodium and bicarbonate in moist soils |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.001 |
|
Non-persistent |
|
|
Sodium hydrogen carbonate spontaneously dissociates to sodium and bicarbonate in moist soils or water. |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
4220 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 8075 |
Gallus domesticus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 559.1 |
as potassium bicarbonate |
Low |
|
|
> 537.4 |
as potassium bicarbonate |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
7100 |
Lepomis macrochirus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1020 |
Ceriodaphnia dubia |
Low |
|
|
- |
- |
- |
|
|
> 500 |
Ceriodaphnia dubia LC₅₀ |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 45 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
422 |
Worst case of acute and chronic mammals |
|
|
807.5 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
10.748 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
71 |
Worst case of temperate acute and chronic fish |
|
|
10.2 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
4.5 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
4220 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 4.74 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
25-75 |
concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
Negligible risks |
|
|
Negligible risks |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
Cardiac depressant in ingested in large quantities Linked with urinary bladder hyperplasia in rats No serious adverse health concerns |
|
|
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
|
Health: H315, H318, H319, H332, H335 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sodium hydrogen carbonate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.